| Company Name: |
SHANG FLUORO Gold |
| Tel: |
021-65170832 15601903708 |
| Email: |
qinba_1@163.com |
|
| | 2,2-Difluoroethyl trifluoromethanesulfonate Basic information |
| Product Name: | 2,2-Difluoroethyl trifluoromethanesulfonate | | Synonyms: | 2,2-DIFLUOROETHYL TRIFLUOROMETHANESULPHONATE;2,2-Difluoroethyl trifluoromethanesulphonate 98%;2,2-Difluoroethyltrifluoromethanesulphonate98%;Trifluoromethanesulfonic acid 2,2-difluoroethyl ester;Methanesulfonic acid, 1,1,1-trifluoro-, 2,2-difluoroethyl ester;1,1,1-Trifluoro-2,2-difluoroethyl Ester Methanesulfonic Acid;2-DIFLUOROETHYL TRIFLUOROMETHANESULFONATE;Difluoroethyl triflate | | CAS: | 74427-22-8 | | MF: | C3H3F5O3S | | MW: | 214.11 | | EINECS: | | | Product Categories: | | | Mol File: | 74427-22-8.mol |  |
| | 2,2-Difluoroethyl trifluoromethanesulfonate Chemical Properties |
| Boiling point | 118-120°C | | density | 1.6150 | | refractive index | 1.3300-1.3340 | | storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C | | form | clear liquid | | color | Colorless to Light yellow | | InChI | InChI=1S/C3H3F5O3S/c4-2(5)1-11-12(9,10)3(6,7)8/h2H,1H2 | | InChIKey | NKULBUOBGILEAR-UHFFFAOYSA-N | | SMILES | C(F)(F)(F)S(OCC(F)F)(=O)=O | | EPA Substance Registry System | 2,2-Difluoroethyl triflate (74427-22-8) |
| | 2,2-Difluoroethyl trifluoromethanesulfonate Usage And Synthesis |
| Uses | 2,2-Difluoroethyl Triflate is used to prepare kinesin spindle protein inhibitors for treatment of taxane-refractory cancer. It is also used to synthesize MexAB-OprM specific efflux pump inhibitors in Pseudomonas aeruginosa. |
| | 2,2-Difluoroethyl trifluoromethanesulfonate Preparation Products And Raw materials |
|