- TRI-M-TOLYL PHOSPHATE
-
- $1.00 / 1KG
-
2019-09-02
- CAS:563-04-2
- Min. Order: 1KG
- Purity: ≥98%
- Supply Ability: 200kg
|
| | TRI-M-TOLYL PHOSPHATE Basic information |
| Product Name: | TRI-M-TOLYL PHOSPHATE | | Synonyms: | Trism-cresyl;Tris-m-cresyl phosphate;tris-m-cresylphosphate;tri-3-cresyl phosphate;TRI-META-TOLYLPHOSPHATE;TRI-META-CRESYLPHOSPHATE;Phosphoric acid tri(3-methylphenyl) ester;Phosphoric acid tris(m-methylphenyl) ester | | CAS: | 563-04-2 | | MF: | C21H21O4P | | MW: | 368.36 | | EINECS: | 209-241-8 | | Product Categories: | | | Mol File: | 563-04-2.mol |  |
| | TRI-M-TOLYL PHOSPHATE Chemical Properties |
| Melting point | 25.5°C | | Boiling point | 410 °C | | density | 1.16 | | refractive index | 1.555-1.557 | | Fp | 210 °C | | storage temp. | Store at room temperature | | Water Solubility | Insoluble in water | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | solid | | color | White or Colorless to Light yellow | | Merck | 14,9763 | | Henry's Law Constant | 1.4×10-1 mol/(m3Pa) at 25℃, Keshavarz et al. (2022) | | InChI | 1S/C21H21O4P/c1-16-7-4-10-19(13-16)23-26(22,24-20-11-5-8-17(2)14-20)25-21-12-6-9-18(3)15-21/h4-15H,1-3H3 | | InChIKey | RMLPZKRPSQVRAB-UHFFFAOYSA-N | | SMILES | Cc1cccc(OP(=O)(Oc2cccc(C)c2)Oc3cccc(C)c3)c1 | | CAS DataBase Reference | 563-04-2 | | EPA Substance Registry System | Tri-m-cresyl phosphate (563-04-2) |
| Hazard Codes | N-Xn,N,Xn | | Risk Statements | 51/53-21/22 | | Safety Statements | 61-28A-28 | | RIDADR | 3082 | | WGK Germany | WGK 3 | | TSCA | TSCA listed | | HazardClass | 9 | | PackingGroup | III | | HS Code | 29199000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Oral Aquatic Chronic 2 | | Hazardous Substances Data | 563-04-2(Hazardous Substances Data) |
| Provider | Language |
|
ACROS
| English |
| | TRI-M-TOLYL PHOSPHATE Usage And Synthesis |
| Chemical Properties | CLEAR VERY SLIGHTLY YELLOW TO PINK LIQUID | | Uses | TRI-M-TOLYL PHOSPHATE is also used to study properties of supercooled liquids. | | General Description | Wax. When mixed with its isomers (ortho and meta ), the result is a colorless, odorless liquid. | | Air & Water Reactions | May hydrolyze under alkaline conditions. . Insoluble in water. | | Reactivity Profile | Organophosphates, such as TRI-M-TOLYL PHOSPHATE, are susceptible to formation of highly toxic and flammable phosphine gas in the presence of strong reducing agents such as hydrides. Partial oxidation by oxidizing agents may result in the release of toxic phosphorus oxides. | | Fire Hazard | Combustible |
| | TRI-M-TOLYL PHOSPHATE Preparation Products And Raw materials |
|