| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
TRIHEXYL PHOSPHATE manufacturers
- Trihexyl phosphate
-
- $1.00
-
2026-08-07
- CAS:2528-39-4
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20000KG
- Trihexyl phosphate
-
- $1000.00
-
2024-02-13
- CAS:2528-39-4
- Min. Order: 1g
- Purity: 98
- Supply Ability: 500 Kg
|
| | TRIHEXYL PHOSPHATE Basic information |
| Product Name: | TRIHEXYL PHOSPHATE | | Synonyms: | phosphoric acid trihexyl ester;TRIHEXYL PHOSPHATE;TRI-N-HEXYLPHOSPHONATE;Tri-n-hexyl phosphate, 90% min;Trihexyl phosphate, 90% min;Tri-n-hexyl phosphate, 90+%;Tri-n-hexyl phosphate;Flame Retardant THP | | CAS: | 2528-39-4 | | MF: | C18H39O4P | | MW: | 350.47 | | EINECS: | 219-774-8 | | Product Categories: | | | Mol File: | 2528-39-4.mol |  |
| | TRIHEXYL PHOSPHATE Chemical Properties |
| Boiling point | 192-193 °C(Press: 6.5 Torr) | | density | 0.9215 g/cm3(Temp: 020 °C) | | vapor pressure | 0.001Pa at 20℃ | | storage temp. | Refrigerator, under inert atmosphere | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Liquid | | color | Colorless | | Water Solubility | 250μg/L at 20℃ | | InChI | InChI=1S/C18H39O4P/c1-4-7-10-13-16-20-23(19,21-17-14-11-8-5-2)22-18-15-12-9-6-3/h4-18H2,1-3H3 | | InChIKey | SFENPMLASUEABX-UHFFFAOYSA-N | | SMILES | P(OCCCCCC)(OCCCCCC)(OCCCCCC)=O | | LogP | 7.04 at 25℃ | | EPA Substance Registry System | Phosphoric acid, trihexyl ester (2528-39-4) |
| TSCA | TSCA listed | | HazardClass | IRRITANT |
| Provider | Language |
|
ALFA
| English |
| | TRIHEXYL PHOSPHATE Usage And Synthesis |
| Uses | Trihexyl Phosphate is used as a modifier in the flame-retardant, polyphenylene oxide. | | Flammability and Explosibility | Not classified |
| | TRIHEXYL PHOSPHATE Preparation Products And Raw materials |
|