- 3-hydroxy-2-picoline
-
- $0.00 / 25KG
-
2025-12-01
- CAS:1121-25-1
- Min. Order: 1KG
- Purity: 98.0%
- Supply Ability: 10000KGS
|
| | 3-Hydroxy-2-methylpyridine Basic information |
| | 3-Hydroxy-2-methylpyridine Chemical Properties |
| Melting point | 168-169 °C (lit.) | | Boiling point | 204.59°C (rough estimate) | | density | 1.1143 (rough estimate) | | refractive index | 1.5040 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO, Methanol | | pka | 10.38±0.10(Predicted) | | form | Powder | | color | Beige-brown | | BRN | 107937 | | InChI | InChI=1S/C6H7NO/c1-5-6(8)3-2-4-7-5/h2-4,8H,1H3 | | InChIKey | AQSRRZGQRFFFGS-UHFFFAOYSA-N | | SMILES | C1(C)=NC=CC=C1O | | LogP | 0.314 (est) | | CAS DataBase Reference | 1121-25-1(CAS DataBase Reference) | | NIST Chemistry Reference | 3-Pyridinol, 2-methyl-(1121-25-1) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-37/38-41-36/37/38 | | Safety Statements | 26-37/39-36/37/39-36 | | WGK Germany | 3 | | HS Code | 29333990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Dam. 1
Skin Irrit. 2
STOT SE 3 |
| | 3-Hydroxy-2-methylpyridine Usage And Synthesis |
| Chemical Properties | beige-brown powder | | Uses | 3-Hydroxy-2-methylpyridine was used in the synthesis of pyrimidine. | | Application | 3-Hydroxy-2-methylpyridine is used in the preparation of substituted pyridine and pyrimidine derivatives and their use in treating viral infections. | | Synthesis Reference(s) | Journal of the American Chemical Society, 71, p. 2969, 1949 DOI: 10.1021/ja01177a007 | | General Description | Vitamin B6 is an active 3-hydroxy-2-methylpyridine derivative. | | Source | 3-Hydroxy-2-methylpyridine (also known as vitamin B6) can be found in several natural sources, includingcertain bacteria, plants, and even in some foods. |
| | 3-Hydroxy-2-methylpyridine Preparation Products And Raw materials |
|