|
|
| | FAST RED VIOLET LB SALT Basic information |
| Product Name: | FAST RED VIOLET LB SALT | | Synonyms: | FAST RED VIOLET LB SALT DYE CONTENT: 85%;5-Chloro-4-benzamido-2-methylbenzenediazonium;chloride hemi(zinc chloride) salt;4-(Benzoylamino)-5-chloro-2-methylbenzenediazonium chloride;FAST RED VIOLET LB SALT;FAST RED VIOLET SALT LB;CI NO 37160;RED VIOLET LB SALT | | CAS: | 32348-81-5 | | MF: | C14H11Cl2N3O | | MW: | 308.16 | | EINECS: | | | Product Categories: | | | Mol File: | 32348-81-5.mol |  |
| | FAST RED VIOLET LB SALT Chemical Properties |
| storage temp. | −20°C | | solubility | H2O: soluble1mg/mL | | form | powder | | Water Solubility | H2O: 1mg/mL | | InChI | InChI=1S/C14H10ClN3O.ClH/c1-9-7-13(11(15)8-12(9)18-16)17-14(19)10-5-3-2-4-6-10;/h2-8H,1H3;1H | | InChIKey | SARKXLKWFKNUMR-UHFFFAOYSA-N | | SMILES | C1(C=C(C([N+]#N)=CC=1Cl)C)NC(=O)C1C=CC=CC=1.[Cl-] | | CAS DataBase Reference | 32348-81-5 |
| | FAST RED VIOLET LB SALT Usage And Synthesis |
| Uses | - Fast Red Violet LB Salt is suitable for quantitating alkaline phosphatase through histochemical, hematological, histological, and flow cytometric methods.
- It has been used to study the role of TNF-α during fracture healing.
- has been used for the detection of tartrate-resistant acid phosphatase (TRAP) in tissue sections.
|
| | FAST RED VIOLET LB SALT Preparation Products And Raw materials |
|