|
|
| | p-Phenylenediamine dihydrochloride Basic information |
| | p-Phenylenediamine dihydrochloride Chemical Properties |
| Melting point | >200°C | | storage temp. | Store below +30°C. | | solubility | Methanol (Slightly), Water (Slightly) | | form | Crystalline Powder | | Colour Index | 76061 | | color | White to purple-gray | | Water Solubility | >=10 g/100 mL at 21 ºC | | Merck | 14,7285 | | BRN | 3911749 | | Stability: | Stable. Incompatible with acids, strong oxidizing agents. | | Cosmetics Ingredients Functions | HAIR DYEING | | InChI | InChI=1S/C6H8N2.2ClH/c7-5-1-2-6(8)4-3-5;;/h1-4H,7-8H2;2*1H | | InChIKey | IYXMNTLBLQNMLM-UHFFFAOYSA-N | | SMILES | C1(N)C=CC(N)=CC=1.Cl.Cl | | CAS DataBase Reference | 624-18-0(CAS DataBase Reference) | | EPA Substance Registry System | 1,4-Phenylenediamine dihydrochloride (624-18-0) |
| Hazard Codes | T,N | | Risk Statements | 23/24/25-36-43-50/53 | | Safety Statements | 28-36/37-45-60-61-28A | | RIDADR | UN 1673 6.1/PG 3 | | WGK Germany | 3 | | RTECS | ST0350000 | | F | 8-9 | | TSCA | TSCA listed | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29215119 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Skin Sens. 1 | | Hazardous Substances Data | 624-18-0(Hazardous Substances Data) | | Toxicity | LD50 orally in Rabbit: 147 mg/kg |
| | p-Phenylenediamine dihydrochloride Usage And Synthesis |
| Chemical Properties | Off-white crystal powder | | Uses | Dihydrochloride salt of 1,4-Phenylenediamine (P319845). A hair dye component, paraphenylenediamine, as a contact allergen for treatment of inflammatory diseases. | | Uses | P-Phenylenediamine Dihydrochloride can be used for coloring of keratinous materials using at least an self-oxidizing dye or a blue, purple or green oxidative dye and at least one fluorescent dye. | | General Description | White to slightly reddish crystals or gray powder. | | Air & Water Reactions | Water soluble. | | Reactivity Profile | Acidic organic/inorganic salts, such as p-Phenylenediamine dihydrochloride, are generally soluble in water. The resulting solutions contain moderate to high concentrations of hydrogen ions and have pH's of less than 7.0. They react as acids to neutralize bases. These neutralizations generate heat, but less or far less than is generated by neutralization of inorganic acids, inorganic oxoacids, and carboxylic acid. They usually do not react as either oxidizing agents or reducing agents but such behavior is not impossible. Many of these compounds catalyze organic reactions. | | Fire Hazard | Flash point data for p-Phenylenediamine dihydrochloride are not available; however, p-Phenylenediamine dihydrochloride is probably combustible. |
| | p-Phenylenediamine dihydrochloride Preparation Products And Raw materials |
|