|
|
| | 2-Mercapto-5-methyl-1,3,4-thiadiazole Basic information |
| Product Name: | 2-Mercapto-5-methyl-1,3,4-thiadiazole | | Synonyms: | 2,3-Dihydro-5-methyl-1,3,4-thiadiazole-2-thione;2-Methyl-1,3,4-thiadiazole-5(4H)-thione;MMTD
2-Methyl-5-mercapto-1,3,4-thiadiazole;2-Mercapto-5-Methyl-1;MMTD)2-Mercapto-5-Methyl-1;Cefazolin IMpurity E;2-Mercapto-5-methyl-1,3,4-thiadiazole, 5-Methyl-1,3,4-thiadiazole-2-thiol;2-Methyl-5-thio-1,3,4-thiadiazole | | CAS: | 29490-19-5 | | MF: | C3H4N2S2 | | MW: | 132.21 | | EINECS: | 249-667-1 | | Product Categories: | chemical additive;pharmaceutical intermediate;THIOL;API intermediates;Cephalosporins | | Mol File: | 29490-19-5.mol |  |
| | 2-Mercapto-5-methyl-1,3,4-thiadiazole Chemical Properties |
| Melting point | 185-188 °C | | Boiling point | 182.9±23.0 °C(Predicted) | | density | 1.373 (estimate) | | refractive index | 1.5500 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | chloroform: soluble10mg/mL, clear to very slightly hazy, colorless | | pka | 6.49±0.40(Predicted) | | form | solid | | color | White to Off-White | | Water Solubility | 2 g/100 mL | | BRN | 606663 | | InChI | InChI=1S/C3H4N2S2/c1-2-4-5-3(6)7-2/h1H3,(H,5,6) | | InChIKey | FPVUWZFFEGYCGB-UHFFFAOYSA-N | | SMILES | S1C(C)=NNC1=S | | CAS DataBase Reference | 29490-19-5(CAS DataBase Reference) | | NIST Chemistry Reference | 1,3,4-Thiadiazole-2(3H)-thione, 5-methyl-(29490-19-5) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-Mercapto-5-methyl-1,3,4-thiadiazole Usage And Synthesis |
| Chemical Properties | white crystal powder | | Uses | thiadiazole pharmaceutical intermediate | | Uses | 5-Methyl-1,3,4-thiadiazol-2-thiol (Cefazolin EP Impurity E), is a new potent nitrification inhibitors. It is also an intermediate in the synthesis of Thiazolylacetylglycine Oxime (T344230). | | General Description | 5-Methyl-1,3,4-thiadiazole-2-thiol is a pharmaceutical intermediate. UV and UV/H2O2 induced degradation of 5-methyl-1,3,4-thiadiazole-2-thiol has been investigated. |
| | 2-Mercapto-5-methyl-1,3,4-thiadiazole Preparation Products And Raw materials |
| Raw materials | Ethyl acetate-->Hydrazinium hydroxide solution-->Hydrazine hydrate-->Carbon disulfide-->Potassium formate-->Acethydrazide | | Preparation Products | Methidathion-->Thidiazuron-->Cefozopran-->BISMERTHIAZOL-->5-Amino-1,3,4-thiadiazole-2-thiol-->5-Amino-1,2,3-thiadiazole-->TIADINIL-->Cefazolin-->Cefazolin sodium salt-->7-Amino-3-[(5-methyl-1,3,4-thiadiazol-2-ylthio)methyl]-3-cephem-4-carboxylic Acid-->benzyl 5-methyl-1,3,4-thiadiazol-2-yl sulfide-->1,3,4-Thiadiazole, 2,2'-dithiobis[5-methyl--->Ethyl 4-[(5-methyl-1,3,4-thiadiazol-2-yl)thio]-3-oxobutanoate-->N-(5-METHYL-3-ISOXAZOLYL)-2-[(5-METHYL-1,3,4-THIADIAZOL-2-YL)SULFANYL]ACETAMIDE |
|