| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
4-tert-Butylphthalic anhydride manufacturers
|
| | 4-tert-Butylphthalic anhydride Basic information |
| Product Name: | 4-tert-Butylphthalic anhydride | | Synonyms: | 4-TERT-BUTYLPHTHALIC ANHYDRIDE;5-(1,1demethylethyl)-1,3-isobenzofurandione;5-tert-Butylisobenzofuran-1,3-dione;4-tert-Butylphthalic Anhydride;4-tert-Butylphthalic Anhydride >;1,3-Isobenzofurandione, 5-(1,1-dimethylethyl)-;5-tert-butyl-2-benzofuran-1,3-dione;4-tert-Butylphthalic anhydride 98% | | CAS: | 32703-79-0 | | MF: | C12H12O3 | | MW: | 204.22 | | EINECS: | 251-165-2 | | Product Categories: | B;Stains and Dyes;Stains&Dyes, A to | | Mol File: | 32703-79-0.mol |  |
| | 4-tert-Butylphthalic anhydride Chemical Properties |
| Melting point | 70-75 °C(lit.) | | Boiling point | 136 °C / 2mmHg | | density | 1.206±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | form | Crystalline Powder | | color | White to off-white | | Major Application | diagnostic assay manufacturing
hematology
histology | | InChI | 1S/C12H12O3/c1-12(2,3)7-4-5-8-9(6-7)11(14)15-10(8)13/h4-6H,1-3H3 | | InChIKey | YLJYVKLZVHWUCT-UHFFFAOYSA-N | | SMILES | CC(C)(C)c1ccc2C(=O)OC(=O)c2c1 | | CAS DataBase Reference | 32703-79-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2917.39.7000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4-tert-Butylphthalic anhydride Usage And Synthesis |
| Chemical Properties | Off-white solid | | Uses | 4-tert-Butylphthalic Anhydride is a standard for environmental testing and research. Reagent for the structure-based design of phthalimides as potential cyclooxygenase-2 inhibitors with anti-inflammatory and analgesic activities. Dyes and metabolites. |
| | 4-tert-Butylphthalic anhydride Preparation Products And Raw materials |
|