|
|
| | 4-TERT-BUTYLPHTHALONITRILE Basic information |
| | 4-TERT-BUTYLPHTHALONITRILE Chemical Properties |
| Melting point | 49-51 °C(lit.) | | Boiling point | 165-168 °C6 mm Hg(lit.) | | density | 1.04±0.1 g/cm3 (20 ºC 760 Torr) | | refractive index | 1.6266 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | color | White to Light yellow | | Major Application | diagnostic assay manufacturing hematology histology | | InChI | 1S/C12H12N2/c1-12(2,3)11-5-4-9(7-13)10(6-11)8-14/h4-6H,1-3H3 | | InChIKey | LOTMIRVNJTVTSU-UHFFFAOYSA-N | | SMILES | CC(C)(C)c1ccc(C#N)c(c1)C#N |
| WGK Germany | 3 | | HS Code | 29269090 | | Storage Class | 13 - Non Combustible Solids |
| | 4-TERT-BUTYLPHTHALONITRILE Usage And Synthesis |
| Uses | diagnostic assay manufacturing hematology histology |
| | 4-TERT-BUTYLPHTHALONITRILE Preparation Products And Raw materials |
|