| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-tert-Butoxycarbonyloxyphenylboronic acid, pinacol ester Basic information |
| Product Name: | 2-tert-Butoxycarbonyloxyphenylboronic acid, pinacol ester | | Synonyms: | tert-Butyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenylcarbonate, tert-Butyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl carbonate;t-Butyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenylcarbonate,min.97%;t-Butyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl carbonate, min. 97%;2-T-BUTOXYCARBOXYPHENYLBORONIC ACID, PINACOL ESTER;(2-TERT-BUTOXYCARBOXY)BENZENEBORONIC ACID, PINACOL ESTER;T-BUTYL-2-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENYL CARBONATE;TERT-BUTYL-2-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXA-BOROLAN-2-YL)PHENYL CARBONATE;carbonic acid tert-butyl [2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] ester | | CAS: | 480424-71-3 | | MF: | C17H25BO5 | | MW: | 320.19 | | EINECS: | | | Product Categories: | blocks;BoronicAcids;Heterocyclic Compounds;organic or inorganic borate | | Mol File: | 480424-71-3.mol |  |
| | 2-tert-Butoxycarbonyloxyphenylboronic acid, pinacol ester Chemical Properties |
| Melting point | 73-77 °C(lit.) | | storage temp. | 2-8°C | | form | Powder | | color | pale yellow | | InChI | 1S/C17H25BO5/c1-15(2,3)21-14(19)20-13-11-9-8-10-12(13)18-22-16(4,5)17(6,7)23-18/h8-11H,1-7H3 | | InChIKey | JWSZKSKLMRKJHM-UHFFFAOYSA-N | | SMILES | CC(C)(C)OC(=O)Oc1ccccc1B2OC(C)(C)C(C)(C)O2 | | CAS DataBase Reference | 480424-71-3 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 2-tert-Butoxycarbonyloxyphenylboronic acid, pinacol ester Usage And Synthesis |
| | 2-tert-Butoxycarbonyloxyphenylboronic acid, pinacol ester Preparation Products And Raw materials |
|