| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-Methoxyphenylboronic acid pinacol ester Basic information |
| Product Name: | 2-Methoxyphenylboronic acid pinacol ester | | Synonyms: | 2-(2-METHOXYLOXYPHENYL)-4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLANE;2-METHOXYPHENYLBORONIC ACID, PINACOL ESTER;2-METHOXYBENZENEBORONIC ACID, PINACOL ESTER;2-Methoxybenzeneboronic acid, pinacol ester 97%;2-(2-Methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-;2-(2-Methoxyloxyphenyl)-4;2-Methoxy-1-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)benzene;o-(Pinacolboryl)anisol | | CAS: | 190788-60-4 | | MF: | C13H19BO3 | | MW: | 234.1 | | EINECS: | | | Product Categories: | blocks;BoronicAcids | | Mol File: | 190788-60-4.mol |  |
| | 2-Methoxyphenylboronic acid pinacol ester Chemical Properties |
| Melting point | 78-80 | | Boiling point | 328.5±25.0 °C(Predicted) | | density | 1.02±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | soluble in Methanol | | form | powder to crystal | | color | White to Almost white | | InChI | 1S/C13H19BO3/c1-12(2)13(3,4)17-14(16-12)10-8-6-7-9-11(10)15-5/h6-9H,1-5H3 | | InChIKey | ASDFSWMHZSWXPO-UHFFFAOYSA-N | | SMILES | B2(OC(C(O2)(C)C)(C)C)c1c(cccc1)OC | | CAS DataBase Reference | 190788-60-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids |
| | 2-Methoxyphenylboronic acid pinacol ester Usage And Synthesis |
| Uses | 2-Methoxyphenylboronic Acid Pinacol Ester is used in the preparation of inhibitors of TGF-β1 and activin A signalling. |
| | 2-Methoxyphenylboronic acid pinacol ester Preparation Products And Raw materials |
|