| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Fumaric-2,3-d2 acid Basic information |
| | Fumaric-2,3-d2 acid Chemical Properties |
| Melting point | 299-300 °C (subl.) (lit.) | | Fp | 230℃ | | solubility | DMSO (Slightly), Methanol (Sparingly) | | form | Solid | | color | White to Off-White | | InChI | 1S/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8)/b2-1+/i1D,2D | | InChIKey | VZCYOOQTPOCHFL-FBBQFRKLSA-N | | SMILES | [2H]\C(=C(\[2H])C(O)=O)C(O)=O | | CAS Number Unlabeled | 110-17-8 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-41-36 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | Fumaric-2,3-d2 acid Usage And Synthesis |
| Uses | Fumaric Acid-d2 is the isotope labelled analog of Fumaric Acid. Fumaric acid is a compound that occurs in many plants. It is essential to vegetable and tissue respiration and also used as an antioxidant. Fumaric acid is also a metabolite of Dimethyl Fumarate (D464965), a compound used as a treatment for the relapsing forms of multiple sclerosis and psoriasis. |
| | Fumaric-2,3-d2 acid Preparation Products And Raw materials |
|