|
|
| | Fumaric acid-d4 Basic information |
| | Fumaric acid-d4 Chemical Properties |
| Melting point | 299-300 °C (subl.)(lit.) | | form | solid | | InChI | 1S/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8)/b2-1+/i1D,2D/hD2 | | InChIKey | VZCYOOQTPOCHFL-JXRVJRKUSA-N | | SMILES | [2H]OC(=O)\C([2H])=C(/[2H])C(=O)O[2H] | | CAS Number Unlabeled | 110-17-8 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | Fumaric acid-d4 Usage And Synthesis |
| Uses | Fumaric acid-d4 is the deuterium labeled Fumaric acid[1]. Fumaric acid, associated with fumarase deficiency, is identified as an oncometabolite or an endogenous, cancer causing metabolite[2]. | | References | [1] Russak EM, et al. Impact of Deuterium Substitution on the Pharmacokinetics of Pharmaceuticals. Ann Pharmacother. 2019 Feb;53(2):211-216. DOI:10.1177/1060028018797110 [2] Whelan DT, et al. Fumaric aciduria: a new organic aciduria, associated with mental retardation and speech impairment. Clin Chim Acta. 1983 Aug 31;132(3):301-8. DOI:10.1016/0009-8981(83)90008-6 |
| | Fumaric acid-d4 Preparation Products And Raw materials |
|