- chloride ionophore i
-
- $2.00 / 1KG
-
2019-12-31
- CAS:32195-55-4
- Min. Order: 1KG
- Purity: ≥98%
- Supply Ability: 20tons
|
| | Manganese(III) meso -tetraphenylporphine chloride Basic information |
| Product Name: | Manganese(III) meso -tetraphenylporphine chloride | | Synonyms: | MESO-TETRAPHENYLPORPHYRIN MANGANESE (III) CHLORIDE COMPLEX;CHLORIDE IONOPHORE I;5,10,15,20-TETRAPHENYLPORPHYRIN-MN(III) CHLORIDE;5,10,15,20-TETRAPHENYL-21H,23H-PORPHINE MANGANESE(III) CHLORIDE;RARECHEM AS SA 0005;PROTOPORPHYRIN IX MN(III) CHLORIDE;Manganese, chloro[5,10,15,20-tetraphenyl-21H,23H-porphinato(2-)-N21,N22,N23,N24]-(SP-5-12)-;CHLORIDE IONOPHORE I SELECTOPHORE | | CAS: | 32195-55-4 | | MF: | C44H28ClMnN4 | | MW: | 703.11 | | EINECS: | | | Product Categories: | | | Mol File: | 32195-55-4.mol |  |
| | Manganese(III) meso -tetraphenylporphine chloride Chemical Properties |
| Melting point | >320 °C | | storage temp. | Inert atmosphere,Room Temperature | | form | powder | | color | Brown to black | | λmax | 475 nm 583 nm (2nd) | | BRN | 5699425 | | InChIKey | MIUMWNDEIWVIEG-YKKPBKTHSA-M | | SMILES | N12[Mn](Cl)N3C4C=CC3=C(C3C=CC(N=3)=C(C3=CC=CC=C3)C1=CC=C2C(C1=CC=CC=C1)=C1C=CC(C=4C2=CC=CC=C2)=N1)C1=CC=CC=C1 |c:8,15,42,t:37| |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2934999090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Manganese(III) meso -tetraphenylporphine chloride Usage And Synthesis |
| Uses | Tetraphenylporphyrin manganese (III) chloride complex generally finds application in determining histidine in aqueous solutions by resonance light scattering technique. | | General Description | Visit our Sensor Applications portal to learn more. | | reaction suitability | reagent type: catalyst core: manganese |
| | Manganese(III) meso -tetraphenylporphine chloride Preparation Products And Raw materials |
|