|
|
| | CHLORIDE IONOPHORE IV Basic information |
| Product Name: | CHLORIDE IONOPHORE IV | | Synonyms: | Bisthiourea-1;CHLORIDE IONOPHORE IV SELECTOPHORE;2,7-Di-tert-butyl-9,9-dimethyl-4,5-bis(N'-n-butyl-thioureido)xanthene;1-butyl-3-[2,7-ditert-butyl-5-(butylcarbamothioylamino)-9,9-dimethylxanthen-4-yl]thiourea;Thiourea, N,N''-[2,7-bis(1,1-dimethylethyl)-9,9-dimethyl-9H-xanthene-4,5-diyl]bis[N'-butyl-;1,1'-(2,7-di-tert-butyl-9,9-dimethyl-9H-xanthene-4,5-diyl)bis(3-butylthiourea) | | CAS: | 187404-67-7 | | MF: | C33H50N4OS2 | | MW: | 582.91 | | EINECS: | | | Product Categories: | | | Mol File: | 187404-67-7.mol |  |
| | CHLORIDE IONOPHORE IV Chemical Properties |
| Boiling point | 597.1±60.0 °C(Predicted) | | density | 1.105±0.06 g/cm3(Predicted) | | pka | 12.47±0.40(Predicted) | | form | powder | | color | White to off-white | | InChIKey | GYGZJHGSLBVTPV-UHFFFAOYSA-N | | SMILES | CCCCNC(=S)Nc1cc(cc2c1Oc3c(NC(=S)NCCCC)cc(cc3C2(C)C)C(C)(C)C)C(C)(C)C |
| WGK Germany | 3 | | F | 10-23 | | Storage Class | 11 - Combustible Solids |
| | CHLORIDE IONOPHORE IV Usage And Synthesis |
| Uses | Chloride Ionophore IV is a thiourea type hydrogen bonding-based receptor. Chloride Ionophore IV is a chloride ionophore[1][2]. | | References | [1] Wang X, et al. An Ionophore-Based Anion-Selective Optode Printed on Cellulose Paper. Angew Chem Int Ed Engl. 2017 Sep 18;56(39):11826-11830. DOI:10.1002/anie.201706147
[2] Ganguly A, Prasad S. Passively Addressable Ultra-Low Volume Sweat Chloride Sensor. Sensors (Basel). 2019 Oct 22;19(20):4590. DOI:10.3390/s19204590 |
| | CHLORIDE IONOPHORE IV Preparation Products And Raw materials |
|