| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | N-Carbobenzoxy-4-oxo-L-proline Basic information |
| Product Name: | N-Carbobenzoxy-4-oxo-L-proline | | Synonyms: | N-carbobenzyloxy-4-keto-L-proline;Carbobenzoxyoxoproline;(S)-1-((Benzyloxy)carbonyl)-4-oxopyrrolidine-2-carboxylic acid;1-(Benzyloxycarbonyl)-4-keto-(S)-proline;(S)-1-Z-4-oxopyrrolidine-2-carboxylic acid
;1-Benzyloxycarbonyl-4-oxo-L-proline;(2S)-4-oxo-1,2-Pyrrolidinedicarboxylic acid 1-(phenylmethyl) ester;1-(benzyloxycarbonyl)-4-oxopyrrolidine-2-carboxylic acid | | CAS: | 64187-47-9 | | MF: | C13H13NO5 | | MW: | 263.25 | | EINECS: | | | Product Categories: | | | Mol File: | 64187-47-9.mol |  |
| | N-Carbobenzoxy-4-oxo-L-proline Chemical Properties |
| Melting point | 95℃ | | Boiling point | 488.5±45.0 °C(Predicted) | | density | 1.408±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 3.83±0.20(Predicted) | | form | Powder | | color | White to yellow to brown | | Optical Rotation | [α]22/D +6.0°, c = 1 in chloroform | | Major Application | peptide synthesis | | InChI | 1S/C13H13NO5/c15-10-6-11(12(16)17)14(7-10)13(18)19-8-9-4-2-1-3-5-9/h1-5,11H,6-8H2,(H,16,17)/t11-/m0/s1 | | InChIKey | RPLLCMZOIFOBIF-NSHDSACASA-N | | SMILES | OC(=O)[C@@H]1CC(=O)CN1C(=O)OCc2ccccc2 | | CAS DataBase Reference | 64187-47-9 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2933998090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | N-Carbobenzoxy-4-oxo-L-proline Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: solution phase peptide synthesis |
| | N-Carbobenzoxy-4-oxo-L-proline Preparation Products And Raw materials |
|