| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 3-(Dimethylamino)-1-(4-fluorophenyl)-2-propen-1-one Basic information |
| Product Name: | 3-(Dimethylamino)-1-(4-fluorophenyl)-2-propen-1-one | | Synonyms: | 2-Propen-1-one, 3-(diMethylaMino)-1-(4-fluorophenyl)-;3-(Dimethylamino)-1-(4-fluorophenyl)prop-2-en-1-one;(E)-3-dimethylamino-1-(4-fluorophenyl)prop-2-en-1-one;(E)-3-Dimethylamino-1-(4-fluoro-phenyl)-propenone;2-Propen-1-one, 1-(4-fluorophenyl)-3-dimethylamino-;3-(4-Fluorophenyl)-N,N-dimethylacrylamide;Propenone, 1-(4-fluorophenyl)-3-dimethylamino-;3-Dimethylamino-1-(4-fluorophenyl)-2-propen-1-one,97% | | CAS: | 75175-77-8 | | MF: | C11H12FNO | | MW: | 193.22 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 3-(Dimethylamino)-1-(4-fluorophenyl)-2-propen-1-one Chemical Properties |
| Melting point | 84-86° | | Boiling point | 271.648±40.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.101±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 6.375±0.70(predicted) | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C11H12FNO/c1-13(2)8-7-11(14)9-3-5-10(12)6-4-9/h3-8H,1-2H3 | | InChIKey | GTJNUCRUOWBWEW-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(F)C=C1)(=O)C=CN(C)C | | CAS DataBase Reference | 75175-77-8 |
| HazardClass | IRRITANT | | HS Code | 2922390090 |
| | 3-(Dimethylamino)-1-(4-fluorophenyl)-2-propen-1-one Usage And Synthesis |
| | 3-(Dimethylamino)-1-(4-fluorophenyl)-2-propen-1-one Preparation Products And Raw materials |
|