|
|
| | (1S,2S)-1,2-Bis(2,4,6-trimethylphenyl)ethylenediamine Basic information |
| Product Name: | (1S,2S)-1,2-Bis(2,4,6-trimethylphenyl)ethylenediamine | | Synonyms: | (1S,2S)-1,2-BIS(2,4,5-TRIMETHYLPHENYL)ETHYLENEDIAMINE EP;(S,S)-1,2-Bis(2,4,6-trimethylphenyl)-1,2-ethanediamine dihydrochloride;(1S,2S)-1,2-DIMESITYLETHYLENEDIAMINE;(1S,2S)-1,2-DIAMINO-1,2-DIMESITYLETHANE;(1S,2S)-1,2-Bis(2,4,6-trimethylphenyl)-1,2-ethanediamine hydrate dihydrochloride;(1S,2S)-1,2-Bis(2,4,6-trimethylphenyl)ethylenediamine hydrate dihydrochloride;1,2-Ethanediamine,1,2-bis(2,4,6-trimethylphenyl)-, (1S,2S)-;(S,S)-1,2-Bis(2,4,6-trimethylphenyl)-1,2-ethanediamine | | CAS: | 186769-18-6 | | MF: | C20H28N2 | | MW: | 296.45 | | EINECS: | | | Product Categories: | Amines (Chiral);Chiral Building Blocks;Synthetic Organic Chemistry | | Mol File: | 186769-18-6.mol |  |
| | (1S,2S)-1,2-Bis(2,4,6-trimethylphenyl)ethylenediamine Chemical Properties |
| Melting point | >300 °C | | Boiling point | 451.7±40.0 °C(Predicted) | | density | 1.024±0.06 g/cm3(Predicted) | | solubility | slightly sol. in dichloromethane | | pka | 10.43±0.10(Predicted) | | form | powder to crystal | | color | White to Almost white | | Optical Rotation | [α]20/D 129°, c = 1 in H2O | | InChI | 1S/C20H28N2.2ClH/c1-11-7-13(3)17(14(4)8-11)19(21)20(22)18-15(5)9-12(2)10-16(18)6;;/h7-10,19-20H,21-22H2,1-6H3;2*1H/t19-,20-;;/m0../s1 | | InChIKey | HSFKFAWYBTVLDG-TULUPMBKSA-N | | SMILES | Cl.Cl.Cc1cc(C)c([C@H](N)[C@@H](N)c2c(C)cc(C)cc2C)c(C)c1 | | CAS DataBase Reference | 186769-18-6 |
| WGK Germany | 3 | | HS Code | 2921.51.5000 | | Storage Class | 11 - Combustible Solids |
| | (1S,2S)-1,2-Bis(2,4,6-trimethylphenyl)ethylenediamine Usage And Synthesis |
| | (1S,2S)-1,2-Bis(2,4,6-trimethylphenyl)ethylenediamine Preparation Products And Raw materials |
|