|
|
| | (R)-(-)-N-(3,5-DINITROBENZOYL)-ALPHA-PHENYLGLYCINE Basic information |
| | (R)-(-)-N-(3,5-DINITROBENZOYL)-ALPHA-PHENYLGLYCINE Chemical Properties |
| Melting point | 216-217 °C (lit.) | | Boiling point | 480.21°C (rough estimate) | | density | 1.3660 (rough estimate) | | refractive index | -102 ° (C=1, THF) | | storage temp. | Store below +30°C. | | form | powder to crystal | | color | White to Almost white | | Optical Rotation | [α]20/D 102°, c = 0.9 in THF | | BRN | 4719763 | | Major Application | peptide synthesis | | InChI | InChI=1/C15H11N3O7/c19-14(16-13(15(20)21)9-4-2-1-3-5-9)10-6-11(17(22)23)8-12(7-10)18(24)25/h1-8,13H,(H,16,19)(H,20,21)/t13-/s3 | | InChIKey | MIVUDAUOXJDARR-ZDUSSCGKSA-N | | SMILES | C(O)(=O)[C@H](C1=CC=CC=C1)NC(=O)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1 |&1:3,r| | | CAS DataBase Reference | 74927-72-3(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 10-21 | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids |
| | (R)-(-)-N-(3,5-DINITROBENZOYL)-ALPHA-PHENYLGLYCINE Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | (R)-(-)-N-(3,5-Dinitrobenzoyl)-alpha-phenylglycine | | reaction suitability | reaction type: solution phase peptide synthesis |
| | (R)-(-)-N-(3,5-DINITROBENZOYL)-ALPHA-PHENYLGLYCINE Preparation Products And Raw materials |
|