- Isoguanine
-
- $33.00
-
2026-07-16
- CAS:3373-53-3
- Purity: 99.93%
- Supply Ability: 10g
|
| | 6-Amino-3,7-dihydro-2H-purin-2-one Basic information |
| | 6-Amino-3,7-dihydro-2H-purin-2-one Chemical Properties |
| Melting point | 300 °C | | Boiling point | 273.11°C (rough estimate) | | density | 1.4456 (rough estimate) | | refractive index | 1.8000 (estimate) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Aqueous Base (Slightly) | | form | Powder | | pKa | 5.32±0.40(Predicted) | | color | Off-white to slightly beige | | Water Solubility | SLIGHTLY SOLUBLE | | Stability: | Hygroscopic | | InChI | InChI=1S/C5H5N5O/c6-3-2-4(8-1-7-2)10-5(11)9-3/h1H,(H4,6,7,8,9,10,11) | | InChIKey | DRAVOWXCEBXPTN-UHFFFAOYSA-N | | SMILES | N1C2=C(NC(=O)N=C2N)N=C1 | | CAS DataBase Reference | 3373-53-3(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 24/25 | | WGK Germany | WGK 3 | | HS Code | 29335995 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| Provider | Language |
|
ACROS
| English |
| | 6-Amino-3,7-dihydro-2H-purin-2-one Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | A nucleotide base as immunostimulator agent. | | Definition | ChEBI: An oxopurine that is 3,7-dihydro-purin-2-one in which the hydrogen at position 6 is substituted by an amino group. | | Synthesis Reference(s) | Journal of the American Chemical Society, 81, p. 2442, 1959 DOI: 10.1021/ja01519a042 |
| | 6-Amino-3,7-dihydro-2H-purin-2-one Preparation Products And Raw materials |
|