| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- M-METHYLPROPIOPHENONE
-
- $10.00
-
2026-09-15
- CAS:51772-30-6
- Min. Order: 1ASSAYS
- Purity: 99%
- Supply Ability: 10 tons
- Methylpropiophenone
-
- $600.00
-
2026-09-15
- CAS:51772-30-6
- Min. Order: 1kg
- Purity: ≥99%
- Supply Ability: 200kg/month
- M-METHYLPROPIOPHENONE
-
- $200.00
-
2026-08-26
- CAS:51772-30-6
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 99999
|
| | m-Methylpropiophenone Basic information | | Uses |
| Product Name: | m-Methylpropiophenone | | Synonyms: | 1-Propanone,1-(3-Methylphenyl)-;ETHYL-M-TOLYL KETONE;1-(3-methylphenyl)propan-1-one;1-(3-Methylphenyl)-1-propanone;Einecs 257-405-2;Tolperisone Impurity E;Tolperisone Impurity 5;1-M-tolylpropan-1-one | | CAS: | 51772-30-6 | | MF: | C10H12O | | MW: | 148.2 | | EINECS: | 257-405-2 | | Product Categories: | | | Mol File: | 51772-30-6.mol |  |
| | m-Methylpropiophenone Chemical Properties |
| Melting point | -4.4°C | | Boiling point | 235°C (estimate) | | density | 1.0059 | | refractive index | 1.5413 (estimate) | | storage temp. | Refrigerator, Under inert atmosphere | | solubility | Chloroform (Soluble), Methanol (Sparingly) | | form | Oil | | color | Colourless | | InChI | InChI=1S/C10H12O/c1-3-10(11)9-6-4-5-8(2)7-9/h4-7H,3H2,1-2H3 | | InChIKey | QHVNQIJBHWOZRJ-UHFFFAOYSA-N | | SMILES | C(C1=CC=CC(C)=C1)(=O)CC |
| | m-Methylpropiophenone Usage And Synthesis |
| Uses | Bupropion analogues are representative of the new generation of drugs for treating depression, with good therapeutic effects and fewer side effects, and are widely needed in clinical treatment. 3'-Methylphenylacetone is a key intermediate in the preparation of bupropion analogues. | | Chemical Properties | colorless to light yellow luqid |
| | m-Methylpropiophenone Preparation Products And Raw materials |
|