|
|
| | Chitobiose 2HCl Basic information |
| Product Name: | Chitobiose 2HCl | | Synonyms: | CHITOBIOSE DIHYDROCHLORIDE;N-[5-[3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,4-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide;Chitotriose 2HCl;D-Glucose, 2-amino-4-o-(2-amino-2-deoxy-beta-D-glucopyranosyl)-2-deoxy-;Chitobiose 2HCl;Chitobiose Hydrochloride;4-O-(2-Amino-2-deoxy-beta-D-glucosyl)-D-glucosamine;beta-D-glucosaminyl-(1->4)-aldehydo-D-glucosamine | | CAS: | 577-76-4 | | MF: | C12H24N2O9 | | MW: | 340.33 | | EINECS: | | | Product Categories: | | | Mol File: | 577-76-4.mol |  |
| | Chitobiose 2HCl Chemical Properties |
| Boiling point | 736.2±60.0 °C(Predicted) | | density | 1.58±0.1 g/cm3(Predicted) | | pka | 11.01±0.45(Predicted) | | form | powder | | color | white to off-white | | InChI | 1S/C12H24N2O9.2ClH/c13-5-9(19)10(4(2-16)21-11(5)20)23-12-6(14)8(18)7(17)3(1-15)22-12;;/h3-12,15-20H,1-2,13-14H2;2*1H/t3-,4-,5-,6-,7-,8-,9-,10-,11,12+;;/m1../s1 | | InChIKey | QBSWPIQMUDKRHR-SORUAGQPSA-N | | SMILES | O[C@@H]1[C@@H](N)[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](N)[C@H]2O)O[C@H](CO)[C@H]1O.Cl.Cl |
| Safety Statements | 24/25 | | WGK Germany | WGK 3 | | HS Code | 29400090 | | Storage Class | 11 - Combustible Solids |
| | Chitobiose 2HCl Usage And Synthesis |
| Chemical Properties | reducing terminal of N-linked oligosaccharides, lectin inhibitor, lysozyme substrate | | Uses | Chitobiose, a chitosan oligosaccharide, is a dimer of β-1,4-linked glucosamine units[1]. Chitobiose has orally activity and high antioxidant activity[2]. | | Definition | ChEBI: Beta-D-glucosaminyl-(1->4)-aldehydo-D-glucosamine is a member of chitobioses. | | in vivo | Chitobiose (30, 100, 300 mg/kg; p.o., single) can enters the circulatory system when given orally[2].
Pharmacokinetic Parameters of Chitobiose in Wistar strain male rats[2].
| PO (30 mg/kg) | PO (100 mg/kg) | PO (300 mg/kg) | | Tmax (h) | 0.9 | 1.0 | 1.8 | | Cpmax (μg/mL) | 1.1 | 4.4 | 6.9 | | AUC0-4h (μg·h/mL) | 2.5 | 9.0 | 17.6 | | AUMC0-4h (μg·h^2/mL) | 4.0 | 13.2 | 35.6 | | MRT (h) | 1.6 | 1.5 | 1.6 | | MAT (h) | 1.1 | 1.0 | 1.2 | | ka (h^-1) | 0.95 | 0.99 | 0.96 | | F1-4h (%) | 1.8 | 2.0 | 1.3 |
| Animal Model: | Wistar strain male rats (7 weeks, 165-185 g)[2] | | Dosage: | 30, 100, 300 mg/kg | | Administration: | p.o., single (Pharmacokinetics analysis) | | Result: | Entered the circulatory system when given orally. |
| | References | [1] Zhao Q, et al. Chitoheptaose Promotes Heart Rehabilitation in a Rat Myocarditis Model by Improving Antioxidant, Anti-Inflammatory, and Antiapoptotic Properties. Oxid Med Cell Longev. 2020;2020:2394704. Published 2020 Apr 11. DOI:10.1155/2020/2394704
[2] Chen AS, Taguchi T, Okamoto H, et al. Pharmacokinetics of chitobiose and chitotriose administered intravenously or orally to rats. Biol Pharm Bull. 2005;28(3):545-548. DOI:10.1248/bpb.28.545 |
| | Chitobiose 2HCl Preparation Products And Raw materials |
|