| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3,3'-Azodibenzoic acid Basic information |
| Product Name: | 3,3'-Azodibenzoic acid | | Synonyms: | AZONENZENE-3,3'-DICARBOXYLIC ACID;AZOBENZENE-3,;3-[(3-carboxyphenyl)diazenyl]benzoic acid;3,3'-(Diazene-1,2-diyl)dibenzoic acid;Benzoic acid, 3,3'-(1,2-diazenediyl)bis-;3-(3-carboxyphenyl)azobenzoic acid;Azobenzene-3,3'-dicarboxylic Acid >;Azobenzene-3,3'-dicarboxylic Acid | | CAS: | 621-18-1 | | MF: | C14H10N2O4 | | MW: | 270.24 | | EINECS: | | | Product Categories: | | | Mol File: | 621-18-1.mol |  |
| | 3,3'-Azodibenzoic acid Chemical Properties |
| Melting point | 170-171 °C | | Boiling point | 561.4±35.0 °C(Predicted) | | density | 1.35±0.1 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 3.54±0.10(Predicted) | | form | powder to crystal | | color | Light yellow to Brown | | InChI | InChI=1S/C14H10N2O4/c17-13(18)9-3-1-5-11(7-9)15-16-12-6-2-4-10(8-12)14(19)20/h1-8H,(H,17,18)(H,19,20) | | InChIKey | QBVIXYABUQQSRY-FOCLMDBBSA-N | | SMILES | N(C1C=CC=C(C=1)C(O)=O)=NC1C=CC=C(C=1)C(O)=O | | CAS DataBase Reference | 621-18-1 |
| | 3,3'-Azodibenzoic acid Usage And Synthesis |
| Uses | 3,3'-AZODIBENZOIC ACID is used as a ligand in the synthesis of MOF materials. |
| | 3,3'-Azodibenzoic acid Preparation Products And Raw materials |
|