| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4,4'-Azodibenzoyl dichloride Basic information | | Uses |
| Product Name: | 4,4'-Azodibenzoyl dichloride | | Synonyms: | AZOBENZENE-4-BENZOYL CHLORIDE;Benzoyl chloride, 4,4'-azobis-;4-[(4-carbonochloridoylphenyl)diazenyl]benzoyl Chloride;Azobenzene-4,4'-dicarbonyl Dichloride >;Benzoyl chloride, 4,4'-(1,2-diazenediyl)bis-;DK7540;DK7714;Azobenzene-4,4'-dicarbonyl Dichloride | | CAS: | 10252-29-6 | | MF: | C14H8Cl2N2O2 | | MW: | 307.13 | | EINECS: | | | Product Categories: | | | Mol File: | 10252-29-6.mol |  |
| | 4,4'-Azodibenzoyl dichloride Chemical Properties |
| Melting point | 164 °C | | Boiling point | 458.6±30.0 °C(Predicted) | | density | 1.37±0.1 g/cm3(Predicted) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | Chloroform (Slightly) | | form | Solid | | color | Dark Red | | Stability: | Moisture Sensitive | | InChI | 1S/C14H8Cl2N2O2/c15-13(19)9-1-5-11(6-2-9)17-18-12-7-3-10(4-8-12)14(16)20/h1-8H/b18-17+ | | InChIKey | ASOXKYGOZZTVHL-ISLYRVAYSA-N | | SMILES | ClC(=O)c1ccc(cc1)\N=N\c2ccc(cc2)C(Cl)=O |
| Hazard Codes | C,N | | Risk Statements | 34-50/53 | | Safety Statements | 26-36/37/39-45-60-61 | | RIDADR | 3261 | | WGK Germany | WGK 3 | | HS Code | 2927.00.5000 | | HazardClass | 8 | | PackingGroup | III | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Aquatic Acute 1
Skin Corr. 1C |
| | 4,4'-Azodibenzoyl dichloride Usage And Synthesis |
| Uses | Azobenzene-4,4'-dicarbonyl chloride is an organic intermediate that can be prepared by first preparing azobenzene-4,4'-dicarboxylic acid from p-aminobenzoic acid, and then reacting the carboxylic acid with thionyl chloride to produce azobenzene-4,4'-dicarbonyl chloride. |
| | 4,4'-Azodibenzoyl dichloride Preparation Products And Raw materials |
|