| Company Name: |
Tocopharm Co., Ltd. |
| Tel: |
+86-021-69895597 13776836200 +86-13776836200 |
| Email: |
tocopharm@gmail.com |
- PROPAQUIZAFOP
-
-
2025-07-25
- CAS:111479-05-1
- Min. Order: 2mg
- Purity: 99% HPLC
- Supply Ability: 20kg
- PROPAQUIZAFOP
-
- $1.00
-
2020-01-17
- CAS:111479-05-1
- Min. Order: 1KG
- Purity: 85.0-99.8%
- Supply Ability: 200kgs
|
| | PROPAQUIZAFOP Basic information |
| Product Name: | PROPAQUIZAFOP | | Synonyms: | PROPAQUIZAFOP;(r)-lidene)amino)oxy)ethyleste;2-(4-((6-chloro-2-quinoxalinyl)oxy)phenoxy)-propanoicaci2-(((1-methylethy;2-isopropylideneamino-oxyethyl(r)-2-(4-(6-chloroquinoxalin-2-yloxy)phenoxy)p;ro17-3664;shogun;(R)-2(((1-methylethylidene)amino)oxy)ethyl-2-(4-((6-chloro-2-quinoxalinyl)oxy)phenoxy)propanoate;2-isopropylideneaminooxyethyl(R)-2-(4-(6-chloroquinoxalin-2-yloxy)phenoxy)propionate | | CAS: | 111479-05-1 | | MF: | C22H22ClN3O5 | | MW: | 443.88 | | EINECS: | | | Product Categories: | | | Mol File: | 111479-05-1.mol |  |
| | PROPAQUIZAFOP Chemical Properties |
| Melting point | 62-64° | | alpha | D20 +29.7° (c = 0.93% in chloroform) | | Boiling point | 582.7±60.0 °C(Predicted) | | density | d20 1.29 | | refractive index | 1.6500 (estimate) | | Fp | >100 °C | | storage temp. | 0-6°C | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Solid | | pka | -1.41±0.48(Predicted) | | color | White | | Water Solubility | 627ug/L(temperature not stated) | | Merck | 13,7898 | | Henry's Law Constant | 3.2×106 mol/(m3Pa) at 25℃, Duchowicz et al. (2020) | | Major Application | agriculture
environmental | | InChI | 1S/C22H22ClN3O5/c1-14(2)26-29-11-10-28-22(27)15(3)30-17-5-7-18(8-6-17)31-21-13-24-20-12-16(23)4-9-19(20)25-21/h4-9,12-13,15H,10-11H2,1-3H3/t15-/m1/s1 | | InChIKey | FROBCXTULYFHEJ-OAHLLOKOSA-N | | SMILES | C[C@@H](Oc1ccc(Oc2cnc3cc(Cl)ccc3n2)cc1)C(=O)OCCO\N=C(\C)C | | LogP | 4.600 | | EPA Substance Registry System | Propanoic acid, 2-[4-[(6-chloro-2-quinoxalinyl)oxy]phenoxy]-, 2-[[(1-methylethylidene)amino]oxy]ethyl ester, (2R)- (111479-05-1) |
| Hazard Codes | Xn | | Risk Statements | 20 | | Safety Statements | 22 | | RIDADR | 3077 | | WGK Germany | 2 | | RTECS | UA2458258 | | HazardClass | 9 | | PackingGroup | III | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1
Skin Sens. 1B | | Toxicity | LD50 in rats (mg/kg): >5000 orally; >2000 dermally (Bocion) |
| | PROPAQUIZAFOP Usage And Synthesis |
| Chemical Properties | Whoa ester is colorless crystal (industrial product is orange or brown powder), melting point 66.3 ℃, 260 ℃ decomposition. Relative density 1.35(20℃), vapor pressure 4.4×10-7 mPa(25℃). Distribution coefficient Koclg P=4.78(25℃).Henry's constant 9.2×10-8Pa-m3/mol.Solubility in water(25℃)0.63g/m3;Solubility in other solvents(25℃,g/L):Acetone,Dichloromethane,Ethyl acetate,Toluene>500,Methanol76,n-Octanol30,n-Hexane11.At room temperature,closed Stable ≥2y in a closed container at room temperature; Hydrolysis DT50 (25°C): 10.5d (pH 5), 32d (pH 7), 12.9h (pH 9). pKa is stable to UV. Stable to UV. pKa2.3. | | Uses | Herbicide. | | Uses | Propaquizafop is used in the studies of the pesticides residue in tomatoes and cucumbers and the associated health risks. | | Production Methods | The production of propaquizafop involves a multi-step synthesis beginning with 2,6-dichloroquinoxaline as the core starting material. This compound undergoes sequential reactions with acetone, hydroxylamine hydrochloride, ethylene oxide, hydroquinone, thionyl chloride, and formamide to build the complex molecular structure of propaquizafop, a selective post-emergence herbicide. | | Definition | ChEBI: A quinoxaline derivative used as systemic herbicide for annual and perennial grasses. | | Mechanism of action | Systemic, absorbed by foliage and roots and translocated. Acetyl CoA carboxylase inhibitor (ACCase) - distrupts fatty acid biosynthesis and lipid formation. | | Pesticide Type | Herbicide |
| | PROPAQUIZAFOP Preparation Products And Raw materials |
|