| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | Methyl (R)-(+)-2-(4-hydroxyphenoxy)propanoate Basic information |
| | Methyl (R)-(+)-2-(4-hydroxyphenoxy)propanoate Chemical Properties |
| Melting point | 64-67 °C (lit.) | | Boiling point | 313.4±17.0 °C(Predicted) | | density | 1.187±0.06 g/cm3(Predicted) | | vapor pressure | 0Pa at 20℃ | | refractive index | 42.5 ° (C=1, CHCl3) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | 9320 in mg/100g standard fat at 20 ℃ | | pka | 10.07±0.15(Predicted) | | form | powder to crystal | | color | White to Orange to Green | | Optical Rotation | [α]22/D +43°, c = 1 in chloroform | | Water Solubility | 13.46g/L at 20℃ | | InChI | 1S/C10H12O4/c1-7(10(12)13-2)14-9-5-3-8(11)4-6-9/h3-7,11H,1-2H3/t7-/m1/s1 | | InChIKey | UUYSCNGPNOYZMC-SSDOTTSWSA-N | | SMILES | COC(=O)[C@@H](C)Oc1ccc(O)cc1 | | LogP | 1.29 at 22℃ | | CAS DataBase Reference | 96562-58-2(CAS DataBase Reference) | | EPA Substance Registry System | Propanoic acid, 2-(4-hydroxyphenoxy)-, methyl ester, (2R)- (96562-58-2) |
| Hazard Codes | Xi | | Risk Statements | 41-52/53 | | Safety Statements | 26-39-61 | | WGK Germany | 2 | | HS Code | 29181990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 3
Eye Dam. 1 |
| | Methyl (R)-(+)-2-(4-hydroxyphenoxy)propanoate Usage And Synthesis |
| Uses | Methyl 2-(4-Hydroxyphenoxy)propionate is an intermediate in the synthesis of (±)-Fluazifop (F407430), a grass-selective herbicide which inhibits acetyl-CoA carboxylase in sensitive plant species. | | Flammability and Explosibility | Not classified |
| | Methyl (R)-(+)-2-(4-hydroxyphenoxy)propanoate Preparation Products And Raw materials |
|