1,3-DIHYDRO-2H-INDOLE-2-THIONE manufacturers
|
| | 1,3-DIHYDRO-2H-INDOLE-2-THIONE Basic information |
| Product Name: | 1,3-DIHYDRO-2H-INDOLE-2-THIONE | | Synonyms: | 1H-Indole-2(3H)-thione;2,3-Dihydro-1H-indole-2-thione;2-Indolinethione;2H-Indole-2-thione, 1,3-dihydro- (9ci);Benzazoline-2-thione;Brn 0002992;1,3-Dihydro-indole-2-thione;1,3-DIHYDRO-2H-INDOLE-2-THIONE | | CAS: | 496-30-0 | | MF: | C8H7NS | | MW: | 149.21 | | EINECS: | | | Product Categories: | | | Mol File: | 496-30-0.mol |  |
| | 1,3-DIHYDRO-2H-INDOLE-2-THIONE Chemical Properties |
| Boiling point | 243℃ | | density | 1.27 | | Fp | 101℃ | | storage temp. | 2-8°C, stored under nitrogen | | solubility | Dichloromethane + Methanol, DMSO | | form | Solid | | color | Yellowish | | InChI | InChI=1S/C8H7NS/c10-8-5-6-3-1-2-4-7(6)9-8/h1-4H,5H2,(H,9,10) | | InChIKey | IGJWTYFTQNHSEK-UHFFFAOYSA-N | | SMILES | S=C1NC2=CC=CC=C2C1 |
| WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 2933998090 | | Storage Class | 11 - Combustible Solids |
| | 1,3-DIHYDRO-2H-INDOLE-2-THIONE Usage And Synthesis |
| Uses | Indoline-2-thione is an intermediate in the synthesis of Brassilexin (B676870). Brassilexin is a novel sulphur-containing phytoalexin from Brassica Juncea L. | | reaction suitability | reaction type: Photocatalysis |
| | 1,3-DIHYDRO-2H-INDOLE-2-THIONE Preparation Products And Raw materials |
|