|
|
| | DI-TERT-BUTYLCHLOROSILANE Basic information |
| Product Name: | DI-TERT-BUTYLCHLOROSILANE | | Synonyms: | Di-tert-butylchlorosilane 99%;CHLORO-DI-TERT-BUTYLSILANE;DI-T-BUTYLCHLOROSILANE;DI-TERT-BUTYLCHLOROSILANE;Silane, chlorobis(1,1-dimethylethyl)-;DI-TERT-BUTYLCHLOROSILANE USP/EP/BP;Di-tert-butylchlorosilane | | CAS: | 56310-18-0 | | MF: | C8H19ClSi | | MW: | 178.77 | | EINECS: | | | Product Categories: | | | Mol File: | 56310-18-0.mol |  |
| | DI-TERT-BUTYLCHLOROSILANE Chemical Properties |
| Boiling point | 82-84 °C/45 mmHg (lit.) | | density | 0.884 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.441(lit.) | | Fp | 103 °F | | form | Liquid | | Specific Gravity | 0.884 | | color | Clear colorless | | Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents | | BRN | 2203045 | | Stability: | Stable. Flammable. Incompatible with strong oxidizing agents. | | InChI | 1S/C8H19ClSi/c1-7(2,3)10(9)8(4,5)6/h10H,1-6H3 | | InChIKey | OGWXFZNXPZTBST-UHFFFAOYSA-N | | SMILES | CC(C)(C)[SiH](Cl)C(C)(C)C | | CAS DataBase Reference | 56310-18-0 |
| Hazard Codes | C | | Risk Statements | 10-34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 2986 8/PG 2 | | WGK Germany | 3 | | F | 10-21 | | TSCA | No | | HazardClass | 8 | | PackingGroup | II | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 3
Skin Corr. 1B |
| | DI-TERT-BUTYLCHLOROSILANE Usage And Synthesis |
| Chemical Properties | solid | | Physical properties | bp 82–85°C/45 mmHg; flash point 39°C (closed
cup); d 0.880 g cm3. | | Uses | Considerable study of
alkoxysilanes as intramolecular hydrogen transfer agents has
been undertaken.The di-t-butyloxysilanes, prepared from di-tbutylchlorosilane
and the requisite alcohol, are particularly effective
and are generally stable to column chromatography.
Treatment of a γ-iodoallylic alcohol with NaH and t-Bu2SiHCl
afforded the corresponding di-t-butyloxysilanes which were exposed
to UV irradiation in the presence of 10% hexabutylditin
in the so-called unimolecular chain transfer (UMCT) reaction of
silicon hydrides to afford the reduced alkene (eq 1）. | | Preparation | can be prepared by the chlorination of
di-t-butylsilane or by treatment of silicon tetrachloride with t-
BuLi. |
| | DI-TERT-BUTYLCHLOROSILANE Preparation Products And Raw materials |
|