|
|
| | 2-Keto-D-glucose Basic information |
| | 2-Keto-D-glucose Chemical Properties |
| Melting point | 118-120°C | | Boiling point | 481.0±45.0 °C(Predicted) | | density | 1.574±0.06 g/cm3(Predicted) | | storage temp. | Hygroscopic, Store under Inert atmosphere -20°C Freezer | | solubility | Methanol (Slightly), Water (Slightly) | | pka | 11.33±0.20(Predicted) | | form | Solid | | color | Off-White to Dark Yellow | | Stability: | Hygroscopic | | InChI | 1S/C6H10O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,4-6,8,10-12H,2H2/t4-,5-,6-/m1/s1 | | InChIKey | DCNMIDLYWOTSGK-HSUXUTPPSA-N | | SMILES | OC[C@@H](O)[C@@H](O)[C@H](O)C(=O)C=O | | CAS DataBase Reference | 1854-25-7 |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29144000 | | Storage Class | 11 - Combustible Solids |
| | 2-Keto-D-glucose Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | 2-Keto-D-glucose is a useful synthetic intermediate. | | Definition | ChEBI: D-glucosone is a ketoaldohexose. | | Biological Activity | 2-Keto-D-glucose is the key intermediate of a secondary metabolic pathway leading to the antibiotic β-pyrone cortalcerone. This antibiotic offers protection to fungi against bacteria. The enzymatic oxidation of d-glucose by pyanose 2 oxidase results in 2-keto-D-glucose, and is considered as rare sugar. |
| | 2-Keto-D-glucose Preparation Products And Raw materials |
|