HEPTAFLUORO-1-METHOXYPROPANE manufacturers
- FNM7000
-
- $0.00 / 1kg
-
2026-01-06
- CAS:375-03-1
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 1ton
|
| | HEPTAFLUORO-1-METHOXYPROPANE Basic information |
| Product Name: | HEPTAFLUORO-1-METHOXYPROPANE | | Synonyms: | HEPTAFLUOROPROPYL METHYL ETHER;HEPTAFLUORO-1-METHOXYPROPANE;1,1,1,2,2,3,3-Heptafluoro-3-methoxypropane;1,1,1,2,2,3,3-heptafluoro-3-methoxy-Propane;Methyl heptafluoropropyl ether;Heptafluoropropylmethylether98%;1,1,1,2,2,3,3-heptafluoro-3-methoxy-Propan;Propane,1,1,1,2,2,3,3-heptafluoro-3-methoxy- | | CAS: | 375-03-1 | | MF: | C4H3F7O | | MW: | 200.05 | | EINECS: | | | Product Categories: | refrigerants | | Mol File: | 375-03-1.mol |  |
| | HEPTAFLUORO-1-METHOXYPROPANE Chemical Properties |
| Melting point | -123 | | Boiling point | 34 | | density | 1.409 | | refractive index | 1.3597 (estimate) | | storage temp. | room temp | | form | liquid | | color | colorless to yellow | | Major Application | diagnostic assay manufacturing hematology histology | | InChI | InChI=1S/C4H3F7O/c1-12-4(10,11)2(5,6)3(7,8)9/h1H3 | | InChIKey | NOPJRYAFUXTDLX-UHFFFAOYSA-N | | SMILES | C(F)(F)(F)C(F)(F)C(F)(F)OC | | Surface tension | 15.89 mN/m at 261.89K | | EPA Substance Registry System | Propane, 1,1,1,2,2,3,3-heptafluoro-3-methoxy- (375-03-1) |
| Hazard Codes | Xi | | WGK Germany | WGK 1 | | Hazard Note | Irritant | | TSCA | TSCA listed | | HS Code | 2909199060 | | Storage Class | 11 - Combustible Solids |
| | HEPTAFLUORO-1-METHOXYPROPANE Usage And Synthesis |
| Uses | Heptafluoro-1-methoxypropane is used in preparation method of Isolated Hydrofluoroether. |
| | HEPTAFLUORO-1-METHOXYPROPANE Preparation Products And Raw materials |
| Raw materials | 1-Propene, 1,2,3,3,3-pentafluoro-1-methoxy--->Propane, 1,1,1,2,2,3,3-heptafluoro-3-(fluoromethoxy)--->Pentane, 1,1,1,2,2,3,3,5,5,5-decafluoro-4-methyl-4-(trifluoromethyl)--->Fluorosulfuric acid, 1-fluoro-1-(pentafluoroethyl)-2,2-bis(trifluoromethyl)-1,2-ethanediyl ester (9CI)-->Carbonofluoridic acid, methyl ester-->Hypofluorous acid, methyl ester (9CI)-->PENTAFLUOROPROPIONYL FLUORIDE-->HEPTAFLUOROISOPROPYL METHYL ETHER-->Hexafluoropropylene oxide-->Dimethyl sulfate-->Dimethyl carbonate | | Preparation Products | Trifluoromethyl trifluorovinyl ether-->Methyl pentafluoropropionate |
|