| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (S,S)-(-)-1,2-Di(1-naphthyl)-1,2-ethanediol Basic information |
| Product Name: | (S,S)-(-)-1,2-Di(1-naphthyl)-1,2-ethanediol | | Synonyms: | (S,S)-1,2-DI(1-NAPHTHYL)-1,2-ETHANEDIOL;(S,S)-(-)-1,2-DI(1-NAPTHYL)-1,2-ETHANEDIOL;1,2-Ethanediol, 1,2-di-1-naphthalenyl-, (1S,2S)-;(1S,2S)-1,2-di(naphthalen-1-yl)ethane-1,2-diol;(S,S)-(?)-1,2-Di(1-naphthyl)-1,2-ethanediol;(S,S)-(-)-1,2-Di(1-naphthyl)-1,2-ethanediol | | CAS: | 229184-99-0 | | MF: | C22H18O2 | | MW: | 314.38 | | EINECS: | | | Product Categories: | organic building block;Chiral Building Blocks;Organic Building Blocks;Polyols | | Mol File: | 229184-99-0.mol |  |
| | (S,S)-(-)-1,2-Di(1-naphthyl)-1,2-ethanediol Chemical Properties |
| Melting point | 149-151 °C (lit.) | | storage temp. | Store at 0-8 °C | | Optical Rotation | [α]23/D 25°, c = 1 in chloroform | | InChI | 1S/C22H18O2/c23-21(19-13-5-9-15-7-1-3-11-17(15)19)22(24)20-14-6-10-16-8-2-4-12-18(16)20/h1-14,21-24H/t21-,22-/m0/s1 | | InChIKey | MNRCSHSTIWDUPJ-VXKWHMMOSA-N | | SMILES | O[C@H]([C@@H](O)c1cccc2ccccc12)c3cccc4ccccc34 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (S,S)-(-)-1,2-Di(1-naphthyl)-1,2-ethanediol Usage And Synthesis |
| Uses | (S, S)-(-)-1,2-Di(1-naphthyl)-1,2-ethanediol can be used as:
- A ligand in the asymmetric sulfoxidation of dihydrothienopyrimidine.
- A reactant for the preparation of (2S,2′S)-[(1S,2S)-1,2-bis(naphthalen-1-yl)ethane-1,2-diyl] bis[2-(dimethylamino)propanoate], a chiral bisester ligand via condensation reaction with N,N-dimethylamino acid using aldol-Tishchenko condensation catalyst.
- A reactant to synthesize diol-SnCl4 chiral Bronsted acid complex, which is employed as a catalyst in the allylboration of aldehydes.
|
| | (S,S)-(-)-1,2-Di(1-naphthyl)-1,2-ethanediol Preparation Products And Raw materials |
|