|
|
| | Diphenylphosphine oxide Basic information |
| | Diphenylphosphine oxide Chemical Properties |
| Melting point | 56-57 °C(lit.) | | Boiling point | 102-105°C 0,2mm | | refractive index | 1.608-1.61 | | storage temp. | Inert atmosphere,Room Temperature | | pka | 25 (approx) | | form | Crystals | | color | Yellow to light orange | | Water Solubility | Slightly soluble in water. | | Sensitive | Moisture Sensitive | | InChI | InChI=1S/C12H11OP/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,14H | | InChIKey | ASUOLLHGALPRFK-UHFFFAOYSA-N | | SMILES | P(=O)(C1=CC=CC=C1)C1=CC=CC=C1 | | CAS DataBase Reference | 4559-70-0(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26 | | WGK Germany | 2 | | HS Code | 29319090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Diphenylphosphine oxide Usage And Synthesis |
| Chemical Properties | Yellow to light orange crystals | | Uses | suzuki reaction | | Uses | Used in the preparation of triarylphosphine oxides, and as asymmetric catalysts, preparation of alkenyldiphenylphosphine oxides, and Horner-Wittig reagents. It is a ligand for Buchwald-Hartwig Cross Coupling Reaction, Hydrophosphonylations and Suzuki-Miyaura Coupling. | | Definition | ChEBI: Diphenylphosphine oxide is a member of benzenes. | | Synthesis Reference(s) | Journal of the American Chemical Society, 45, p. 165, 1923 DOI: 10.1021/ja01654a024 | | reaction suitability | reagent type: ligand reaction type: Buchwald-Hartwig Cross Coupling Reaction reagent type: ligand reaction type: Hydrophosphonylations reagent type: ligand reaction type: Suzuki-Miyaura Coupling | | Synthesis | There are three main methods for the synthesis of diphenylphosphine oxide. Method 1 is to use POCl3 as raw material, after Foucault alkylation reaction, lithium aluminum hydride reduction to get the target; method 2 is to use diethyl phosphite as raw material, the reaction of Gram's reagent to generate the product; method 3 by Miller et al. to use PCl3 as raw material, after Foucault alkylation reaction, and then the target by the appropriate hydrolysis, but its intermediate Ph2PCl purification is more difficult, and the yield is low, only 37.0%. only 37.0%.
|
| | Diphenylphosphine oxide Preparation Products And Raw materials |
|