| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Diphenylethylphosphine oxide Basic information |
| | Diphenylethylphosphine oxide Chemical Properties |
| Melting point | 120-125 °C (lit.) | | Boiling point | 179-180°C 14mm | | density | 1,064 g/cm3 | | Fp | >110°C | | storage temp. | Store at room temperature | | form | solid | | Appearance | White to off-white Solid | | InChI | 1S/C14H15OP/c1-2-16(15,13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12H,2H2,1H3 | | InChIKey | AKTGKEBIBGSCLD-UHFFFAOYSA-N | | SMILES | CCP(=O)(c1ccccc1)c2ccccc2 | | CAS DataBase Reference | 1733-57-9(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26 | | RIDADR | 3278 | | WGK Germany | 3 | | RTECS | SZ0199240 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Diphenylethylphosphine oxide Usage And Synthesis |
| Uses | Reactant for:
- Regioselective lactonization of unsymmetrical 1,4-diols
- Synthesis of a nanostructured dioxomolybdenum(VI) catalyst for liquid-phase epoxidation of olefins
- Reduction of tertiary phosphine oxides with DIBAL-H
- Diphenylphosphineyl-mediated synthesis of ketones
- Nucleophilic aromatic substitution of hydrogen by phosphorous stabilized carbanions
- Stereospecific reduction to form phosphines
| | Synthesis Reference(s) | Tetrahedron Letters, 24, p. 3931, 1983 DOI: 10.1016/S0040-4039(00)94318-1 | | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling | | storage | DIPHENYLETHYLPHOSPHINE OXIDE is irritant; moisture sensitive; stored under N2; needs refrigeration |
| | Diphenylethylphosphine oxide Preparation Products And Raw materials |
|