- 1-PROPOXY-2-PROPANOL
-
- $5.00
-
2026-05-28
- CAS:1569-01-3
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10000kg
|
| | 1-Propoxy-2-propanol Basic information | | Uses |
| | 1-Propoxy-2-propanol Chemical Properties |
| Melting point | -80°C | | Boiling point | 140-160 °C(lit.) | | density | 0.885 g/mL at 25 °C(lit.) | | vapor pressure | 3.8hPa at 25℃ | | refractive index | n20/D 1.411(lit.) | | Fp | 119 °F | | Water Solubility | Completely soluble in water | | pka | 14.50±0.20(Predicted) | | form | clear liquid | | color | Colorless to Almost colorless | | Henry's Law Constant | 2.9×102 mol/(m3Pa) at 25℃, HSDB (2015) | | Cosmetics Ingredients Functions | SOLVENT | | InChI | InChI=1S/C6H14O2/c1-3-4-8-5-6(2)7/h6-7H,3-5H2,1-2H3 | | InChIKey | FENFUOGYJVOCRY-UHFFFAOYSA-N | | SMILES | C(OCCC)C(O)C | | LogP | 0.621 at 20℃ | | CAS DataBase Reference | 1569-01-3(CAS DataBase Reference) | | EPA Substance Registry System | 1-Propoxy-2-propanol (1569-01-3) |
| Hazard Codes | Xi | | Risk Statements | 10-36/37/38 | | Safety Statements | 16-26-36 | | RIDADR | UN 3271 3/PG 3 | | WGK Germany | 2 | | RTECS | UB9351000 | | TSCA | TSCA listed | | HazardClass | 3.2 | | PackingGroup | III | | HS Code | 29094990 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 | | Hazardous Substances Data | 1569-01-3(Hazardous Substances Data) |
| | 1-Propoxy-2-propanol Usage And Synthesis |
| Uses | 1-Propoxy-2-propanol is mainly used in cleaning agents. Its properties are similar to ethylene glycol butyl ether, but its odor and toxicity are lower, making it a suitable substitute. Its rapid evaporation and excellent solubility in organic stains make it suitable for use in household and industrial cleaners, degreasers, metal cleaners, and hard surface cleaners. It is also an excellent solvent for glass cleaners and general-purpose cleaners. | | Chemical Properties | Clear colorless liquid | | Flammability and Explosibility | Flammable | | Synthesis | 1,2-Epoxypropane is reacted with n-butanol in the presence of a catalyst. Then 1-propoxy-2-propanol is obtained after crude distillation and rectification. | | Toxics Screening Level | The ITSL for 1-propoxy-2-propanol is 86 μg/m3 for 24 hr. averaging. |
| | 1-Propoxy-2-propanol Preparation Products And Raw materials |
|