p-Nitrophenyl-alpha-D-maltoside manufacturers
|
| | p-Nitrophenyl-alpha-D-maltoside Basic information |
| | p-Nitrophenyl-alpha-D-maltoside Chemical Properties |
| Melting point | 145-146℃ (ethanol ligroine ) | | Boiling point | 795.625±60.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.702±0.10 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | −20°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 12.428±0.70(predicted) | | color | White to Off-White | | Water Solubility | water: 49.00-51.00mg/mL, clear, colorless to light yellow | | InChI | 1S/C18H25NO13/c20-5-9-11(22)12(23)14(25)18(30-9)32-16-10(6-21)31-17(15(26)13(16)24)29-8-3-1-7(2-4-8)19(27)28/h1-4,9-18,20-26H,5-6H2 | | InChIKey | IAYJZWFYUSNIPN-APRLWBDKNA-N | | SMILES | [C@@H]1([C@H](O)[C@H]([C@@H](OC2=CC=C([N+]([O-])=O)C=C2)O[C@@H]1CO)O)O[C@@H]1[C@H](O)[C@H]([C@H](O)[C@@H](CO)O1)O |&1:0,1,3,4,16,21,22,24,25,27,r| |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 2940000080 | | Storage Class | 11 - Combustible Solids |
| | p-Nitrophenyl-alpha-D-maltoside Usage And Synthesis |
| Chemical Properties | white to slightly yellow crystalline powder | | Uses | 4-Nitrophenyl-α-D-maltopyranoside is a class of biochemical reagents used in glycobiology research. Glycobiology studies the structure, synthesis, biology, and evolution of sugars. It involves carbohydrate chemistry, enzymology of glycan formation and degradation, protein-glycan recognition, and the role of glycans in biological systems. This field is closely related to basic research, biomedicine, and biotechnology[1]. | | References | [1] Varki A, et al editors. Essentials of Glycobiology [Internet]. 4th ed. Cold Spring Harbor (NY): Cold Spring Harbor Laboratory Press; 2022. PMID:35536922 |
| | p-Nitrophenyl-alpha-D-maltoside Preparation Products And Raw materials |
|