| Company Name: |
Daicel Chiral Technologies (China)CO.,LTD
|
| Tel: |
021-50460086-9 15921403865 |
| Email: |
han_yajun@dctc.daicel.com |
| Products Intro: |
Product Name:Ethyl 4-(piperi-1-yl) piperid-1-carbamate CAS:802277-44-7 Purity:95%HPLC Package:10MG;25MG;50MG;100MG Remarks:DCTI-C-221
|
| Company Name: |
Shanghai Kewel Chemical Co., Ltd.
|
| Tel: |
021-64609169 18901607656 |
| Email: |
greensnown@163.com |
| Products Intro: |
Product Name:Irinotecan Impurity 24 CAS:802277-44-7 Purity:95+ HPLC; Package:10mg;25mg;50mg;100mg
|
|
| | Irinotecan Impurity 24 Basic information |
| | Irinotecan Impurity 24 Chemical Properties |
| Boiling point | 330.9±35.0 °C(Predicted) | | density | 1.078±0.06 g/cm3(Predicted) | | pka | 9.48±0.20(Predicted) | | InChI | InChI=1S/C13H24N2O2/c1-2-17-13(16)15-10-6-12(7-11-15)14-8-4-3-5-9-14/h12H,2-11H2,1H3 | | InChIKey | JDMNOIGSKBKYMX-UHFFFAOYSA-N | | SMILES | N1(C2CCN(C(OCC)=O)CC2)CCCCC1 |
| | Irinotecan Impurity 24 Usage And Synthesis |
| | Irinotecan Impurity 24 Preparation Products And Raw materials |
|