|
|
| | CHEMBRDG-BB 4303055 Basic information |
| Product Name: | CHEMBRDG-BB 4303055 | | Synonyms: | CHEMBRDG-BB 4303055;1-(3-Isopropoxyphenyl)ethanone;1-(3-propan-2-yloxyphenyl)ethanone;1-(3-isopropoxyphenyl)ethanone(SALTDATA: FREE);IVK/9041226;Ethanone, 1-[3-(1-methylethoxy)phenyl]-;1-(3-Isopropoxyphenyl)ethanone;1-(3-Isopropoxyphenyl)ethanone - [K93072] | | CAS: | 114590-73-7 | | MF: | C11H14O2 | | MW: | 178.23 | | EINECS: | | | Product Categories: | | | Mol File: | 114590-73-7.mol |  |
| | CHEMBRDG-BB 4303055 Chemical Properties |
| Boiling point | 150 °C(Press: 13 Torr) | | density | 0.999±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | form | solid | | Appearance | Colorless to light yellow Liquid | | InChI | 1S/C11H14O2/c1-8(2)13-11-6-4-5-10(7-11)9(3)12/h4-8H,1-3H3 | | InChIKey | PFAYDCNYNRMAPO-UHFFFAOYSA-N | | SMILES | O=C(C)C1=CC=CC(OC(C)C)=C1 |
| Hazard Codes | Xi,Xn | | Risk Statements | 22 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | CHEMBRDG-BB 4303055 Usage And Synthesis |
| | CHEMBRDG-BB 4303055 Preparation Products And Raw materials |
|