| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
Hydroquinine (anthraquinone-1 4-diyl) manufacturers
- (DHQ)2AQN 95%
-
- $15.00
-
2021-07-02
- CAS:176097-24-8
- Min. Order: 1KG
- Purity: 99%+ HPLC
|
| | Hydroquinine (anthraquinone-1 4-diyl) Basic information |
| Product Name: | Hydroquinine (anthraquinone-1 4-diyl) | | Synonyms: | (DHQ)2AQN,Hydroquinine anthraquinone-1,4-diyl diether;9,10-Anthracenedione, 1,4-bis[[(8α,9R)-10,11-dihydro-6'-Methoxycinchonan-9-yl]oxy]-;(DHQ)2AQN 95%;1,4-Bis(9-O-dihydroquininyl)anthraquinone;1,4-Bis(dihydroquinine)anthraquinoneanthraquinone;1,4-Bis[[(8a,9R)-10,11-dihydro-6'-methoxycinchonan-9-yl]oxy]-9,10-anthracenedione;1,4-Bis[[(8α,9R)-10,11-dihydro-6'-methoxycinchonan-9-yl]oxy]-9,10-anthracenedione;1,4-Bis[[(8α,9R)-10,11-dihydro-6′-methoxycinchonan-9-yl]oxy]-9,10-anthracenedione | | CAS: | 176097-24-8 | | MF: | C54H56N4O6 | | MW: | 857.05 | | EINECS: | | | Product Categories: | | | Mol File: | 176097-24-8.mol |  |
| | Hydroquinine (anthraquinone-1 4-diyl) Chemical Properties |
| Melting point | ~160 °C (dec.) | | density | 1.33±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | pka | 9.81±0.70(Predicted) | | Appearance | Light yellow to green yellow Solid | | Optical Rotation | [α]20/D +495°, c = 1 in chloroform | | InChIKey | ARCFYUDCVYJQRN-KGHNJIHGSA-N | | SMILES | CC[C@@H]1CN2CC[C@H]1C[C@@H]2[C@H](Oc3ccc(O[C@@H]([C@H]4C[C@@H]5CCN4C[C@H]5CC)c6ccnc7ccc(OC)cc67)c8C(=O)c9ccccc9C(=O)c38)c%10ccnc%11ccc(OC)cc%10%11 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Hydroquinine (anthraquinone-1 4-diyl) Usage And Synthesis |
| Uses | Superior ligand for asymmetric dihydroxylation reactions of most olefins bearing aliphatic substituents or olefins having heteroatoms in the allylic position. |
| | Hydroquinine (anthraquinone-1 4-diyl) Preparation Products And Raw materials |
|