| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Butanedioic acid-13C4 Basic information |
| | Butanedioic acid-13C4 Chemical Properties |
| Melting point | 187-190 °C(lit.) | | Boiling point | 235 °C | | storage temp. | Refrigerator | | solubility | Methanol (Slightly), Water (Slightly) | | form | Solid | | color | White to Pale Beige | | InChI | 1S/C4H6O4/c5-3(6)1-2-4(7)8/h1-2H2,(H,5,6)(H,7,8)/i1+1,2+1,3+1,4+1 | | InChIKey | KDYFGRWQOYBRFD-JCDJMFQYSA-N | | SMILES | O[13C](=O)[13CH2][13CH2][13C](O)=O | | CAS Number Unlabeled | 110-15-6 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-41-38-37 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Dam. 1 |
| | Butanedioic acid-13C4 Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | Succinic Acid-13C4 is a compound useful in organic synthesis. |
| | Butanedioic acid-13C4 Preparation Products And Raw materials |
|