|
|
| | (Chloromethyl)triphenylphosphonium chloride Basic information |
| | (Chloromethyl)triphenylphosphonium chloride Chemical Properties |
| Melting point | 262-264 °C (lit.) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | Fine Crystalline Powder | | color | White to almost white | | Water Solubility | almost transparency | | BRN | 3599784 | | InChI | InChI=1S/C19H17ClP.ClH/c20-16-21(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19;/h1-15H,16H2;1H/q+1;/p-1 | | InChIKey | SXYFAZGVNNYGJQ-UHFFFAOYSA-M | | SMILES | [P+](CCl)(C1C=CC=CC=1)(C1C=CC=CC=1)C1C=CC=CC=1.[Cl-] | | CAS DataBase Reference | 5293-84-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | RTECS | TA1882000 | | HS Code | 29310099 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (Chloromethyl)triphenylphosphonium chloride Usage And Synthesis |
| Chemical Properties | white to almost white fine crystalline powder | | Uses | (Chloromethyl)triphenylphosphonium Chloride is a Wittig reagent. | | Uses | Used for corrosion inhibition of iron
Reactant involved in:
- Acting as a potential electrophile
- Elimination reactions for the synthesis of linear alkynes
- Intramolecular nucleophilic vinylic substitution
- Homologation of aldehydes
- Endo-selective alkynol cycloisomerization
| | Preparation | (Chloromethyl)triphenylphosphonium chliride is available commercially (chloride or iodide salt) or synthetically from Triphenylphosphine and Chloroiodomethane.
| | Reactivity Profile | (Chloromethyl)triphenylphosphonium chliride is a precursor to the chloro-substituted ylide for Wittig reactions with aldehydes and ketones to form 1-chloroalkenes and, after elimination of HCl, terminal alkynes. | | reaction suitability | reaction type: C-C Bond Formation | | Precautions | For best results the anhydrous salt should be used. The ylide, formed from the salt and strong base, will react with air, water, or other acidic protons
|
| | (Chloromethyl)triphenylphosphonium chloride Preparation Products And Raw materials |
|