| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Methyl triphenyl phosphonium chloride Basic information |
| | Methyl triphenyl phosphonium chloride Chemical Properties |
| Melting point | 221°C (dec.) | | Boiling point | 332.65℃ at 101.3kPa | | density | 1.22 at 23℃ | | vapor pressure | 0.001Pa at 40℃ | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Soluble in methanol. | | form | Solid:crystalline | | color | White to Almost white | | Sensitive | Hygroscopic | | InChI | 1S/C19H18P.ClH/c1-20(17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19;/h2-16H,1H3;1H/q+1;/p-1 | | InChIKey | QRPRIOOKPZSVFN-UHFFFAOYSA-M | | SMILES | [Cl-].C[P+](c1ccccc1)(c2ccccc2)c3ccccc3 | | LogP | -1.73 at 20℃ and pH6.3-6.46 | | Surface tension | 71.4mN/m at 1g/L and 20℃ | | CAS DataBase Reference | 1031-15-8(CAS DataBase Reference) |
| Hazard Codes | Xn;N,N,Xn | | Risk Statements | 21/22-38-41-51/53 | | Safety Statements | 22-26-36/37/39-61 | | RIDADR | UN 3077 | | WGK Germany | 2 | | HazardClass | 9 | | PackingGroup | III | | HS Code | 29319090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Acute Tox. 4 Dermal
Aquatic Chronic 2
Eye Dam. 1
Skin Irrit. 2 |
| | Methyl triphenyl phosphonium chloride Usage And Synthesis |
| Uses | Methyltriphenylphosphonium chloride is used as a phase transfer catalyst in synthetic chemistry. It acts as a catalyst for regio-controlled ring-opening polymerization of substituted epoxides. It is utilized for controlling the corrosion iron. It acts as a reactant for intramolecular nitrone cycloaddition. In addition to this, it is used for neoplasm inhibition through antimitochondrial effect. | | reaction suitability | reaction type: C-C Bond Formation |
| | Methyl triphenyl phosphonium chloride Preparation Products And Raw materials |
|