| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | DEXTRORPHAN D-TARTRATE Basic information |
| Product Name: | DEXTRORPHAN D-TARTRATE | | Synonyms: | -Dextrorphan,TartrateSalt;(+)-3-Hydroxy-N-methylmorphinan (+)-tartrate salt, Dextrorphan D-tartrate;()-3-Hydroxy-N-MethylmorphinanTartrateSalt;(9α,13α,14α)-17-Methyl-Morphinan-3-ol (2R,3R)-2,3-Dihydroxybutanedioate;NIH 4591;(9α,13α,14α)-17-(Methyl-d3)-Morphinan-3-ol (2R,3R)-2,3-Dihydroxybutanedioate;d-3-Hydroxy-N-(Methyl-d3)Morphinan Tartrate;Dextrorphan tartrate solution | | CAS: | 143-98-6 | | MF: | C21H29NO7 | | MW: | 407.46 | | EINECS: | 625-185-0 | | Product Categories: | Intermediates & Fine Chemicals;Pharmaceuticals;Chiral Reagents;Heterocycles | | Mol File: | 143-98-6.mol |  |
| | DEXTRORPHAN D-TARTRATE Chemical Properties |
| Melting point | 201-204°C | | Fp | 9℃ | | storage temp. | −70°C | | solubility | H2O: >10mg/mL | | form | powder | | color | white | | Major Application | pharmaceutical | | InChIKey | RWTWIZDKEIWLKQ-FEBOIHDFSA-N | | SMILES | O[C@@H]([C@H](O)C(O)=O)C(O)=O.CN1CC[C@@]23CCCC[C@@H]2[C@@H]1Cc4ccc(O)cc34 | | CAS DataBase Reference | 143-98-6 |
| Hazard Codes | Xn,T,F | | Risk Statements | 22-39/23/24/25-23/24/25-11 | | Safety Statements | 7-16-36/37-45 | | RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution | | WGK Germany | 3 | | RTECS | QD1930000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral | | Toxicity | mouse,LD50,intravenous,42mg/kg (42mg/kg),"Synthetic Analgesics," Oxford, Pergamon Press, 1966Vol. 2, Pg. 77, 1966. |
| | DEXTRORPHAN D-TARTRATE Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | Orally active synthetic morphine analog. Analgesic (narcotic). The labelled d-form of Levorphanol. | | General Description | Pharmaceutical secondary standards for application in quality control provide pharma laboratories and manufacturers with a convenient and cost-effective alternative to the preparation of in-house working standards |
| | DEXTRORPHAN D-TARTRATE Preparation Products And Raw materials |
|