| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1 3 5-Benzenetriacetic acid Basic information | | Uses |
| Product Name: | 1 3 5-Benzenetriacetic acid | | Synonyms: | Benzene-1,3,5-triacetic acid >=97.0% (T);2-[3,5-Bis(carboxymethyl)phenyl]acetic acid;1,3,5-tris(carboxymethyl)benzene;benzene-1,3,5-triacetic acid;2,2',2''-(benzene-1,3,5-triyl)triacetic acid;JACS-4435-67-0;DK7495 | | CAS: | 4435-67-0 | | MF: | C12H12O6 | | MW: | 252.22 | | EINECS: | | | Product Categories: | | | Mol File: | 4435-67-0.mol |  |
| | 1 3 5-Benzenetriacetic acid Chemical Properties |
| Melting point | 210-215 °C | | Boiling point | 534.2±45.0 °C(Predicted) | | density | 1.468±0.06 g/cm3(Predicted) | | form | powder | | pka | 3.69±0.10(Predicted) | | BRN | 9300288 | | InChI | InChI=1S/C12H12O6/c13-10(14)4-7-1-8(5-11(15)16)3-9(2-7)6-12(17)18/h1-3H,4-6H2,(H,13,14)(H,15,16)(H,17,18) | | InChIKey | AJEIBHNKBLRDNT-UHFFFAOYSA-N | | SMILES | C1(CC(O)=O)=CC(CC(O)=O)=CC(CC(O)=O)=C1 | | CAS DataBase Reference | 4435-67-0 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | 1 3 5-Benzenetriacetic acid Usage And Synthesis |
| Uses | 1,3,5-Phenylacetic acid (PPA) is a needle-shaped or prismatic crystal. It is an important chemical raw material used as a pharmaceutical intermediate, as well as in the preparation of bactericides, fungicides, plasticizers, and crosslinking agents. |
| | 1 3 5-Benzenetriacetic acid Preparation Products And Raw materials |
|