| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 5,6-Dimethyl-1,10-phenanthroline Basic information |
| Product Name: | 5,6-Dimethyl-1,10-phenanthroline | | Synonyms: | 1,10-Phenanthroline, 5,6-dimethyl-;5,6-DIMETHYL-1,10-PHENANTHROLINE;5,6-dimethyl-10-phenanthroline;5 6-DIMETHYL-1,10-PHENANTHROLINE ACS;5,6-diMethy-1,10-phenathroline(Monohydrate);5,6-Dimethyl-1,10-phenanthroline 99%;5,6-Dimethyl-1,10-phenanthroline >;SKL190 | | CAS: | 3002-81-1 | | MF: | C14H12N2 | | MW: | 208.26 | | EINECS: | 221-100-2 | | Product Categories: | Heterocyclic Building Blocks;N-Containing;Others | | Mol File: | 3002-81-1.mol |  |
| | 5,6-Dimethyl-1,10-phenanthroline Chemical Properties |
| Melting point | 266-269 °C (lit.) | | Boiling point | 397.0±37.0 °C(Predicted) | | density | 1.178±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | almost transparency in Methanol | | pka | 5.31±0.10(Predicted) | | form | powder to crystal | | color | White to Light yellow | | Sensitive | Hygroscopic | | BRN | 160918 | | InChI | InChI=1S/C14H12N2/c1-9-10(2)12-6-4-8-16-14(12)13-11(9)5-3-7-15-13/h3-8H,1-2H3 | | InChIKey | BRPQDJPJBCQFSR-UHFFFAOYSA-N | | SMILES | N1C2C(=C(C)C(C)=C3C=2N=CC=C3)C=CC=1 | | CAS DataBase Reference | 3002-81-1(CAS DataBase Reference) | | NIST Chemistry Reference | 5,6-Dimethyl-1,10-phenanthroline(3002-81-1) | | EPA Substance Registry System | 1,10-Phenanthroline, 5,6-dimethyl- (3002-81-1) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids |
| | 5,6-Dimethyl-1,10-phenanthroline Usage And Synthesis |
| Uses | 5,6-Dimethyl-1,10-phenanthroline was employed as ligand in the preparation of:
- novel tetrahedral copper(I) mixed-ligand complexes
- mixed ligand Ru(II) complexes
- 5,6-bis(bromomethyl)-1,10-phenanthroline via bromination with N-bromosuccinimide
|
| | 5,6-Dimethyl-1,10-phenanthroline Preparation Products And Raw materials |
|