|
|
| | (R)-(+)-1-(4-Methoxyphenyl)ethylamine Basic information |
| | (R)-(+)-1-(4-Methoxyphenyl)ethylamine Chemical Properties |
| Melting point | <-20°C | | Boiling point | 65°C 0,4mm | | alpha | 32 º (neat) | | density | 1.024 g/mL at 20 °C(lit.) | | refractive index | n20/D 1.533 | | Fp | 65°C/0.38mm | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | liquid | | pka | 9.29±0.10(Predicted) | | Appearance | Colorless to light yellow Liquid | | Water Solubility | Soluble in water (10g/L). | | Sensitive | Air Sensitive | | BRN | 2413029 | | InChI | InChI=1/C9H13NO/c1-7(10)8-3-5-9(11-2)6-4-8/h3-7H,10H2,1-2H3/t7-/s3 | | InChIKey | JTDGKQNNPKXKII-SSDOTTSWSA-N | | SMILES | [C@@H](C1C=CC(OC)=CC=1)(N)C |&1:0,r| | | CAS DataBase Reference | 22038-86-4(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34-22 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 2735 8/PG 3 | | WGK Germany | 3 | | F | 10-34 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29222990 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 3 Eye Dam. 1 Skin Corr. 1B Skin Sens. 1A |
| | (R)-(+)-1-(4-Methoxyphenyl)ethylamine Usage And Synthesis |
| Chemical Properties | Colorless liquid | | Uses | (R)-(+)-1-(4-Methoxyphenyl)ethylamine use in diastereo-and enantioselective Michael addition reactions. Thiazoles has been prepared from (R)-(+)-1-(4-Methoxyphenyl)ethylamine. | | Uses | (R)-(+)-4-Methoxy-α-methylbenzylamine can be used as a reactant to prepare:
- Enantiopure stereoisomers of hemicryptophanes, which are used for the recognition of glucopyranosides.
- Bicyclic Geissman-Waiss lactone via intramolecular ring-closure reaction of the diastereomeric mixture of sulfonium salts.
- N-[(1R)-1-(4-Methoxyphenyl)ethyl]-N′-methylthiourea by reacting with methyl isothiocyanate.
|
| | (R)-(+)-1-(4-Methoxyphenyl)ethylamine Preparation Products And Raw materials |
|