| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 2 3-Dihydro-3-oxo-4H-1 4-benzoxazine-4-& Basic information |
| Product Name: | 2 3-Dihydro-3-oxo-4H-1 4-benzoxazine-4-& | | Synonyms: | JRH-05701, 3-(2,3-Dihydro-3-oxobenzo[b][1,4]oxazin-4-yl)propanoic acid, 97%;3-(3-oxo-2H-benzo[b][1,4]oxazin-4(3H)-yl)propanoic acid;2,3-Dihydro-3-oxo-4H-1,4-benzoxazino-4-propionic acid;2,3-dihydro-3-oxo-4h-1,4-benzoxazine-4-propionic acid;3-(3-oxo-2,3-dihydro-4H-1,4-benzoxazin-4-yl)propanoate;4H-1,4-Benzoxazine-4-propanoic acid, 2,3-dihydro-3-oxo-;2,3-Dihydro-3-oxo-4H-1,4-benzoxazine-4-propionic acid 97%;2 3-DIHYDRO-3-OXO-4H-1 4-BENZOXAZINE | | CAS: | 23866-15-1 | | MF: | C11H11NO4 | | MW: | 221.21 | | EINECS: | | | Product Categories: | API intermediates | | Mol File: | 23866-15-1.mol |  |
| | 2 3-Dihydro-3-oxo-4H-1 4-benzoxazine-4-& Chemical Properties |
| Melting point | 163-166 °C (lit.) | | Boiling point | 525.4±50.0 °C(Predicted) | | density | 1.352±0.06 g/cm3(Predicted) | | pka | 4.30±0.10(Predicted) | | InChI | 1S/C11H11NO4/c13-10-7-16-9-4-2-1-3-8(9)12(10)6-5-11(14)15/h1-4H,5-7H2,(H,14,15) | | InChIKey | BHULHAHXIGPYKV-UHFFFAOYSA-N | | SMILES | OC(=O)CCN1C(=O)COc2ccccc12 |
| WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids |
| | 2 3-Dihydro-3-oxo-4H-1 4-benzoxazine-4-& Usage And Synthesis |
| Uses | 2,5-Dichlorobenzyl bromide may be used in the synthesis of methyl 5-(2,5-dichlorobenzyloxy)-2-hydroxybenzoate and methyl 4-(2,5-dichlorobenzyloxy)-2-hydroxybenzoate via chemoselective alkylation of the hydroxyl group of the corresponding ester. | | General Description | 2,5-Dichlorobenzyl bromide, an aryl halide, is an alkylating agent used in chemical synthesis. |
| | 2 3-Dihydro-3-oxo-4H-1 4-benzoxazine-4-& Preparation Products And Raw materials |
|