|
|
| | 1,4-Benzenediboronic acid bis(pinacol) ester Basic information |
| Product Name: | 1,4-Benzenediboronic acid bis(pinacol) ester | | Synonyms: | benzene-1,4-diboronic acid bispinacol ester;1 4-BENZENEDIBORONIC ACID DIPINACOL EST%;1,4-Benzenediboronic acid bis(pinacol) ester, 97%;Benzene-1,4-diboronic acid, pinacol diester;1,4-Phenylenediboronic acid, pinacol diester;1,4-phenyldiboronic acid, bis(pinacol) ester;1,4-Benzenediboronic acid dipinacol ester, 1,4-Bis(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzene;1,4-Phenylenediboronic acid, pinacol di96% | | CAS: | 99770-93-1 | | MF: | C18H28B2O4 | | MW: | 330.03 | | EINECS: | | | Product Categories: | blocks;BoronicAcids | | Mol File: | 99770-93-1.mol |  |
| | 1,4-Benzenediboronic acid bis(pinacol) ester Chemical Properties |
| Melting point | 241-245 °C | | Boiling point | 416.3±28.0 °C(Predicted) | | density | 1.03±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | soluble in Toluene | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C18H28B2O4/c1-15(2)16(3,4)22-19(21-15)13-9-11-14(12-10-13)20-23-17(5,6)18(7,8)24-20/h9-12H,1-8H3 | | InChIKey | UOJCDDLTVQJPGH-UHFFFAOYSA-N | | SMILES | C1(B2OC(C)(C)C(C)(C)O2)=CC=C(B2OC(C)(C)C(C)(C)O2)C=C1 | | CAS DataBase Reference | 99770-93-1 |
| Hazard Codes | Xi | | WGK Germany | 3 | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids |
| | 1,4-Benzenediboronic acid bis(pinacol) ester Usage And Synthesis |
| Uses | Reagent used for
- Suzuki-Miyaura cross-coupling reactions and polymerizations
Reagent used in Prepration of
- Efficient solar cell photoelectric polymers
- Field-effect transistors and photovoltaic cells
- Fluorescent compounds and materials such as Blue OLED devices, Blue Polymeric Light Emitting Diodes, and White LEDs
|
| | 1,4-Benzenediboronic acid bis(pinacol) ester Preparation Products And Raw materials |
|