| Company Name: |
Ark Pharm, Inc. |
| Tel: |
847-367-3680 |
| Email: |
sales@arkpharminc.com |
|
| | (4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzene Basic information |
| Product Name: | (4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzene | | Synonyms: | Phenylpinacolborane;1,3,2-Dioxaborolane,4,4,5,5-tetraMethyl-2-phenyl-;(Pinacolboryl)benzene;Phenylboronic acid pinacol ester 97%;cyclic tetramethylethylene ester benzeneboronic acid;PHENYL-BORONIC ACID PINACOL ESTER;Benzeneboronic acid, pinacol ester;(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)- | | CAS: | 24388-23-6 | | MF: | C12H17BO2 | | MW: | 204.07 | | EINECS: | | | Product Categories: | | | Mol File: | 24388-23-6.mol |  |
| | (4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzene Chemical Properties |
| Melting point | 27-31 °C(lit.) | | Boiling point | 130°C/20mmHg(lit.) | | density | 0.99±0.1 g/cm3(Predicted) | | Fp | 225 °F | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | powder to lump | | color | White to Almost white | | InChI | 1S/C12H17BO2/c1-11(2)12(3,4)15-13(14-11)10-8-6-5-7-9-10/h5-9H,1-4H3 | | InChIKey | KKLCYBZPQDOFQK-UHFFFAOYSA-N | | SMILES | CC1(C)OB(OC1(C)C)c2ccccc2 | | CAS DataBase Reference | 24388-23-6(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29319090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzene Usage And Synthesis |
| Chemical Properties | White to light yellow crystal | | Uses | suzuki reaction | | Uses | Phenylboronic acid pinacol ester can be used:
- To prepare sulfinamide derivatives by reacting with diethylaminosulfur trifluoride (DAST) and potassium phenyltrifluoroborate.
- As a substrate in the study of Suzuki–Miyaura coupling of various aryl iodides over SiliaCatPd(0).
| | Synthesis Reference(s) | The Journal of Organic Chemistry, 60, p. 7508, 1995 DOI: 10.1021/jo00128a024 | | General Description | Phenylboronic acid, pinacol ester, also known as boronate ester, is generally used in metal-catalyzed C-C bond formation reactions like Suzuki–Miyaurareaction. |
| | (4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzene Preparation Products And Raw materials |
|