| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 4-Bromo-3-chlorobenzoic acid Basic information |
| | 4-Bromo-3-chlorobenzoic acid Chemical Properties |
| Melting point | 220-224 °C | | Boiling point | 333.7±27.0 °C(Predicted) | | density | 1.809±0.06 g/cm3 (20 ºC 760 Torr) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | pka | 3.60±0.10(Predicted) | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C7H4BrClO2/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3H,(H,10,11) | | InChIKey | PSKJIHDVFDVNBU-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(Br)C(Cl)=C1 | | CAS DataBase Reference | 25118-59-6 |
| Hazard Codes | Xn,N,Xi | | Risk Statements | 22-50/53 | | Safety Statements | 60-61 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | HazardClass | IRRITANT | | PackingGroup | Ⅲ | | HS Code | 29163990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Aquatic Acute 1 |
| | 4-Bromo-3-chlorobenzoic acid Usage And Synthesis |
| Chemical Properties | White solid | | Uses | 4-Bromo-3-chlorobenzoic acid is a molecule that belongs to the class of antimicrobial compounds and is used for the treatment of gram-negative pathogens. It inhibits the growth of these bacteria by blocking their ability to synthesize DNA, RNA, and proteins. |
| | 4-Bromo-3-chlorobenzoic acid Preparation Products And Raw materials |
|