| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
|
| | 4-Bromo-2-chlorobenzoic acid Basic information |
| | 4-Bromo-2-chlorobenzoic acid Chemical Properties |
| Melting point | 171-175 °C | | Boiling point | 319.1±27.0 °C(Predicted) | | density | 1.809±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | DMSO, Methanol | | pka | 2.68±0.25(Predicted) | | form | Solid | | color | Off-White | | InChI | InChI=1S/C7H4BrClO2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3H,(H,10,11) | | InChIKey | JAVZWSOFJKYSDY-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(Br)C=C1Cl | | CAS DataBase Reference | 59748-90-2(CAS DataBase Reference) | | NIST Chemistry Reference | 4-Bromo-2-chlorobenzoic acid(59748-90-2) |
| Hazard Codes | Xn,N,Xi | | Risk Statements | 22-50/53 | | Safety Statements | 60-61 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | HazardClass | IRRITANT | | PackingGroup | Ⅲ | | HS Code | 29163990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Aquatic Acute 1 |
| | 4-Bromo-2-chlorobenzoic acid Usage And Synthesis |
| Chemical Properties | Off-White Solid |
| | 4-Bromo-2-chlorobenzoic acid Preparation Products And Raw materials |
|